5-((4-Acrylamidobenzyl)amino)-7-((3,5-dimethoxyphenyl)amino)imidazo[1,2-c]pyrimidine-8-carboxamide

ID: ALA4874902

PubChem CID: 164625706

Max Phase: Preclinical

Molecular Formula: C25H25N7O4

Molecular Weight: 487.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)Nc1ccc(CNc2nc(Nc3cc(OC)cc(OC)c3)c(C(N)=O)c3nccn23)cc1

Standard InChI:  InChI=1S/C25H25N7O4/c1-4-20(33)29-16-7-5-15(6-8-16)14-28-25-31-23(21(22(26)34)24-27-9-10-32(24)25)30-17-11-18(35-2)13-19(12-17)36-3/h4-13,30H,1,14H2,2-3H3,(H2,26,34)(H,28,31)(H,29,33)

Standard InChI Key:  FCRARPUYEPXMIW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    3.6834   -2.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6834   -3.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3954   -4.0709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1074   -3.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3954   -2.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1044   -2.8358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7181   -2.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3884   -1.5373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5710   -1.6184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8221   -4.0747    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8224   -4.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5371   -5.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9677   -2.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9653   -1.6021    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2545   -2.8417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9696   -4.0761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9707   -4.9011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2555   -5.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2563   -6.1367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9720   -6.5490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6882   -6.1310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6838   -5.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4048   -6.5399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4088   -7.3649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5422   -6.5499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5430   -7.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5352   -6.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2489   -6.5467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9643   -6.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9613   -5.3045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2469   -4.8961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6795   -6.5450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6809   -7.3701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3961   -7.7814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9671   -7.7838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3975   -8.6063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  5  1  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
  4 10  1  0
 10 11  1  0
 11 12  1  0
  1 13  1  0
 13 14  1  0
 13 15  2  0
  2 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 21 23  1  0
 23 24  1  0
 19 25  1  0
 25 26  1  0
 12 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 12  1  0
 29 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4874902

    ---

Associated Targets(Human)

ZAP70 Tchem Tyrosine-protein kinase ZAP-70 (2189 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SYK Tclin Tyrosine-protein kinase SYK (7372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.52Molecular Weight (Monoisotopic): 487.1968AlogP: 3.33#Rotatable Bonds: 10
Polar Surface Area: 144.90Molecular Species: NEUTRALHBA: 9HBD: 4
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.71CX Basic pKa: 5.10CX LogP: 3.31CX LogD: 3.31
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -1.06

References

1. Rao D, Li H, Ren X, Sun Y, Wen C, Zheng M, Huang H, Tang W, Xu S..  (2021)  Discovery of a potent, selective, and covalent ZAP-70 kinase inhibitor.,  219  [PMID:33845236] [10.1016/j.ejmech.2021.113393]

Source