5-((4-(tert-Butyl)phenyl)sulfonyl)-2-(2-methoxy-5-methylphenyl)-1-methyl-1H-imidazole

ID: ALA4874930

PubChem CID: 130472022

Max Phase: Preclinical

Molecular Formula: C22H26N2O3S

Molecular Weight: 398.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(C)cc1-c1ncc(S(=O)(=O)c2ccc(C(C)(C)C)cc2)n1C

Standard InChI:  InChI=1S/C22H26N2O3S/c1-15-7-12-19(27-6)18(13-15)21-23-14-20(24(21)5)28(25,26)17-10-8-16(9-11-17)22(2,3)4/h7-14H,1-6H3

Standard InChI Key:  VXCKGIIQUBJXHQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    7.3630  -21.1603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6531  -20.7476    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.6521  -21.5672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4006  -19.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3995  -20.0730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1117  -20.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8254  -20.0725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8226  -19.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1099  -18.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5339  -20.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6206  -21.2948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4244  -21.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8319  -20.7509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2799  -20.1446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1115  -21.3033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3995  -21.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4527  -19.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0629  -20.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8848  -20.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2904  -19.3262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8789  -18.6150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0534  -18.6210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6473  -19.3343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2836  -17.9010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1050  -17.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8712  -17.1914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6919  -17.1858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1074  -18.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
  7 10  1  0
  6 15  1  0
 15 16  1  0
 14 17  1  0
 13  2  1  0
  2 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
  9 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4874930

    ---

Associated Targets(Human)

NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.53Molecular Weight (Monoisotopic): 398.1664AlogP: 4.53#Rotatable Bonds: 4
Polar Surface Area: 61.19Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.84CX LogP: 5.05CX LogD: 5.05
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.65Np Likeness Score: -0.96

References

1. Li Y, Lin W, Wright WC, Chai SC, Wu J, Chen T..  (2021)  Building a Chemical Toolbox for Human Pregnane X Receptor Research: Discovery of Agonists, Inverse Agonists, and Antagonists Among Analogs Based on the Unique Chemical Scaffold of SPA70.,  64  (3.0): [PMID:33497575] [10.1021/acs.jmedchem.0c02201]

Source