The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3S)-3-cyclopropyl-3-((R)-2-(1-((S)-1-(5-fluoro-2-(trifluoromethoxy)phenyl)ethyl)piperidin-4-yl)chroman-7-yl)-2-methylpropanoic acid ID: ALA4874972
PubChem CID: 164626510
Max Phase: Preclinical
Molecular Formula: C30H35F4NO4
Molecular Weight: 549.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](C(=O)O)[C@@H](c1ccc2c(c1)O[C@@H](C1CCN([C@@H](C)c3cc(F)ccc3OC(F)(F)F)CC1)CC2)C1CC1
Standard InChI: InChI=1S/C30H35F4NO4/c1-17(29(36)37)28(21-4-5-21)22-6-3-19-7-9-25(38-27(19)15-22)20-11-13-35(14-12-20)18(2)24-16-23(31)8-10-26(24)39-30(32,33)34/h3,6,8,10,15-18,20-21,25,28H,4-5,7,9,11-14H2,1-2H3,(H,36,37)/t17-,18-,25+,28+/m0/s1
Standard InChI Key: ADYYYLTWZYYGNX-BLHZKRCXSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
37.6761 -11.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6749 -12.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3830 -12.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0926 -12.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0898 -11.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3812 -10.7965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3787 -9.9793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.0852 -9.5686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0828 -8.7514 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.7941 -9.9751 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.7906 -9.1542 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.3828 -13.2511 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.9682 -10.7970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9681 -9.9798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2606 -11.2057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5549 -10.7925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8494 -11.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8454 -12.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5530 -12.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2647 -12.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1362 -12.4214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4348 -12.0058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.4267 -13.6392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1400 -13.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7207 -13.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7291 -12.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0297 -11.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3214 -12.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3168 -13.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0168 -13.6256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6168 -11.9860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6229 -11.1689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9060 -12.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2014 -11.9755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4906 -12.3788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2075 -11.1583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8999 -13.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0345 -10.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2174 -10.4606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
8 11 1 0
3 12 1 0
1 13 1 0
13 14 1 1
13 15 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
21 18 1 1
21 22 1 0
21 24 1 0
22 26 1 0
25 23 1 0
23 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
31 28 1 6
31 32 1 0
31 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
33 37 1 6
38 32 1 0
39 38 1 0
32 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 549.61Molecular Weight (Monoisotopic): 549.2502AlogP: 7.11#Rotatable Bonds: 8Polar Surface Area: 59.00Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.97CX Basic pKa: 7.16CX LogP: 5.11CX LogD: 4.79Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.36Np Likeness Score: -0.04
References 1. Zhao X, Yoon DO, Yoo J, Park HJ.. (2021) Structure-Activity Relationship Study and Biological Evaluation of 2-(Disubstituted phenyl)-indole-5-propanoic Acid Derivatives as GPR40 Full Agonists., 64 (7.0): [PMID:33769827 ] [10.1021/acs.jmedchem.1c00031 ]