(4-(([1,2,4]Triazolo[4,3-a]pyridine-6-carboxamido)methyl)-phenyl)methanamine

ID: ALA4875007

PubChem CID: 164627634

Max Phase: Preclinical

Molecular Formula: C15H15N5O

Molecular Weight: 281.32

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCc1ccc(CNC(=O)c2ccc3nncn3c2)cc1

Standard InChI:  InChI=1S/C15H15N5O/c16-7-11-1-3-12(4-2-11)8-17-15(21)13-5-6-14-19-18-10-20(14)9-13/h1-6,9-10H,7-8,16H2,(H,17,21)

Standard InChI Key:  VVXVQDHPMPUPGD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   24.0512   -7.6616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0512   -8.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7644   -8.8915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4735   -8.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1867   -8.8915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1867   -9.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4735  -10.1256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7644   -9.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9681   -9.9634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4482   -9.3043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.9681   -8.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3380   -8.8915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6289   -8.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9157   -8.8915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9157   -9.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2025  -10.1256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4975   -9.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7843  -10.1256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0752   -9.7129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4975   -8.8915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2025   -8.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  3  8  1  0
  6  9  2  0
  9 10  1  0
 10 11  2  0
  5 11  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 17 20  1  0
 20 21  2  0
 14 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875007

    ---

Associated Targets(Human)

MLLT1 Tchem Protein ENL (186 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 281.32Molecular Weight (Monoisotopic): 281.1277AlogP: 1.12#Rotatable Bonds: 4
Polar Surface Area: 85.31Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.88CX Basic pKa: 9.28CX LogP: -0.28CX LogD: -2.13
Aromatic Rings: 3Heavy Atoms: 21QED Weighted: 0.75Np Likeness Score: -1.98

References

1. Ma XR, Xu L, Xu S, Klein BJ, Wang H, Das S, Li K, Yang KS, Sohail S, Chapman A, Kutateladze TG, Shi X, Liu WR, Wen H..  (2021)  Discovery of Selective Small-Molecule Inhibitors for the ENL YEATS Domain.,  64  (15.0): [PMID:34279931] [10.1021/acs.jmedchem.1c00367]

Source