NA

ID: ALA4875009

PubChem CID: 154634316

Max Phase: Preclinical

Molecular Formula: C21H11FO9

Molecular Weight: 426.31

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2cc3cc(C(=O)O)c(=O)oc3c3cc(C(=O)O)c(=O)oc23)c(F)c1

Standard InChI:  InChI=1S/C21H11FO9/c1-29-9-2-3-10(15(22)6-9)11-4-8-5-13(18(23)24)20(27)30-16(8)12-7-14(19(25)26)21(28)31-17(11)12/h2-7H,1H3,(H,23,24)(H,25,26)

Standard InChI Key:  ATAVZHJGKMSCBP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   32.9793  -11.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6844  -10.6562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6862  -12.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9812  -11.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2782  -12.2881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2741  -13.1026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9791  -13.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6882  -13.1065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3930  -11.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3918  -11.8821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0980  -12.2912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8099  -11.8841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8111  -11.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1004  -10.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5649  -13.5086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5165  -12.2947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5198  -10.6557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2265  -11.0660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5218   -9.8385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9772  -14.3325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2681  -14.7388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6835  -14.7435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2720  -10.6594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2717   -9.8411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5639   -9.4341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8561   -9.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8604  -10.6656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5687  -11.0690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9789   -9.4318    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.1470   -9.4380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1442   -8.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  3 10  2  0
  9  2  2  0
  2  1  1  0
  3  4  1  0
  3  8  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
  6 15  2  0
 12 16  2  0
 17 18  1  0
 17 19  2  0
 13 17  1  0
 20 21  1  0
 20 22  2  0
  7 20  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  1 23  1  0
 24 29  1  0
 26 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875009

    ---

Associated Targets(Human)

GPR35 Tchem G-protein coupled receptor 35 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.31Molecular Weight (Monoisotopic): 426.0387AlogP: 3.11#Rotatable Bonds: 4
Polar Surface Area: 144.25Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 2.53CX Basic pKa: CX LogP: 2.40CX LogD: -4.57
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.37Np Likeness Score: -0.08

References

1. Wei L, Hou T, Li J, Zhang X, Zhou H, Wang Z, Cheng J, Xiang K, Wang J, Zhao Y, Liang X..  (2021)  Structure-Activity Relationship Studies of Coumarin-like Diacid Derivatives as Human G Protein-Coupled Receptor-35 (hGPR35) Agonists and a Consequent New Design Principle.,  64  (5.0): [PMID:33630609] [10.1021/acs.jmedchem.0c01624]

Source