(4-(5-(Piperidin-4-ylmethoxy)-3-(3-(tetrahydrofuran-3-yl)phenyl)pyrazin-2-yl)phenyl)methanamine

ID: ALA4875019

PubChem CID: 164627638

Max Phase: Preclinical

Molecular Formula: C27H32N4O2

Molecular Weight: 444.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCc1ccc(-c2ncc(OCC3CCNCC3)nc2-c2cccc(C3CCOC3)c2)cc1

Standard InChI:  InChI=1S/C27H32N4O2/c28-15-19-4-6-21(7-5-19)26-27(23-3-1-2-22(14-23)24-10-13-32-18-24)31-25(16-30-26)33-17-20-8-11-29-12-9-20/h1-7,14,16,20,24,29H,8-13,15,17-18,28H2

Standard InChI Key:  QZHYMVCFEXLZLB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   30.5236  -27.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5224  -28.0675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2305  -28.4764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.9401  -28.0670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9373  -27.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2287  -26.8391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6485  -28.4745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8163  -28.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8178  -26.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8190  -26.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1120  -25.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4034  -26.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4062  -26.8433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1138  -27.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1124  -28.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4067  -28.4731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4068  -29.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1185  -29.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8212  -29.2869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3555  -28.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0639  -28.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7710  -28.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0652  -29.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4793  -28.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4806  -29.2872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7735  -29.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6951  -25.6144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9880  -26.0241    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.6952  -28.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6096  -27.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8102  -27.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4017  -27.7917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9487  -28.3988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  2  8  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  1  9  1  0
  8 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19  8  1  0
  7 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 22 24  1  0
 23 26  1  0
 24 25  1  0
 25 26  1  0
 12 27  1  0
 27 28  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 29  1  0
 16 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875019

    ---

Associated Targets(Human)

U-87 MG (3946 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

NS3 Genome polyprotein (385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Vero (26788 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.58Molecular Weight (Monoisotopic): 444.2525AlogP: 4.15#Rotatable Bonds: 7
Polar Surface Area: 82.29Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.38CX LogP: 3.33CX LogD: -1.23
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.57Np Likeness Score: -0.49

References

1. Nie S, Yao Y, Wu F, Wu X, Zhao J, Hua Y, Wu J, Huo T, Lin YL, Kneubehl AR, Vogt MB, Ferreon J, Rico-Hesse R, Song Y..  (2021)  Synthesis, Structure-Activity Relationships, and Antiviral Activity of Allosteric Inhibitors of Flavivirus NS2B-NS3 Protease.,  64  (5.0): [PMID:33596380] [10.1021/acs.jmedchem.0c02070]

Source