The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-butyl-6-chloro-2-methoxy-N-(3,4,5-trimethoxyphenyl)acridin-9-amine ID: ALA4875069
PubChem CID: 164628169
Max Phase: Preclinical
Molecular Formula: C27H29ClN2O4
Molecular Weight: 480.99
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCN(c1cc(OC)c(OC)c(OC)c1)c1c2ccc(Cl)cc2nc2ccc(OC)cc12
Standard InChI: InChI=1S/C27H29ClN2O4/c1-6-7-12-30(18-14-24(32-3)27(34-5)25(15-18)33-4)26-20-10-8-17(28)13-23(20)29-22-11-9-19(31-2)16-21(22)26/h8-11,13-16H,6-7,12H2,1-5H3
Standard InChI Key: CVRQZOPDBSDPNT-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
26.6295 -6.0695 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6278 -4.4165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3432 -4.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3439 -5.6524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0593 -6.0634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7743 -5.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7696 -4.8186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0537 -4.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9148 -5.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9171 -4.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2043 -4.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4889 -4.8295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4905 -5.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2038 -6.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6243 -3.5915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3370 -3.1759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0527 -3.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7649 -3.1719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7618 -2.3461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0405 -1.9368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3313 -2.3540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4740 -1.9295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1907 -2.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9080 -3.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1953 -3.5975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4790 -3.1882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7683 -3.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0341 -1.1118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7453 -0.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4810 -3.5817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7771 -6.0725 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.1939 -3.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4815 -4.4019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1985 -4.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 1 1 0
1 4 2 0
3 2 2 0
2 10 1 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 9 2 0
2 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
15 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
20 28 1 0
28 29 1 0
18 30 1 0
13 31 1 0
30 32 1 0
7 33 1 0
33 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.99Molecular Weight (Monoisotopic): 480.1816AlogP: 7.01#Rotatable Bonds: 9Polar Surface Area: 53.05Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.59CX LogP: 6.47CX LogD: 6.07Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.24Np Likeness Score: -0.59
References 1. Ren Y, Ruan Y, Cheng B, Li L, Liu J, Fang Y, Chen J.. (2021) Design, synthesis and biological evaluation of novel acridine and quinoline derivatives as tubulin polymerization inhibitors with anticancer activities., 46 [PMID:34455231 ] [10.1016/j.bmc.2021.116376 ]