1-(4-(3-azabicyclo[3.1.0]hexan-3-yl)-3-cyano-2-methylbenzyl)-N-((R)-1-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-4-yl)-1H-imidazole-4-carboxamide

ID: ALA4875151

PubChem CID: 156826644

Max Phase: Preclinical

Molecular Formula: C25H27N7O

Molecular Weight: 441.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(Cn2cnc(C(=O)N[C@@H]3CCc4c3ncn4C)c2)ccc(N2CC3CC3C2)c1C#N

Standard InChI:  InChI=1S/C25H27N7O/c1-15-16(3-5-22(19(15)8-26)32-10-17-7-18(17)11-32)9-31-12-21(27-14-31)25(33)29-20-4-6-23-24(20)28-13-30(23)2/h3,5,12-14,17-18,20H,4,6-7,9-11H2,1-2H3,(H,29,33)/t17?,18?,20-/m1/s1

Standard InChI Key:  GIEYEOLNHMBEJX-AFMYVXGZSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
    4.1712   -9.2078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1701  -10.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8781  -10.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5878  -10.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5849   -9.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8763   -8.7989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4606  -10.4368    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7143  -10.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3745  -11.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5751  -11.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1643  -10.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7535  -11.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4600   -8.7976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7522   -8.3892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8739   -7.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2911   -8.7930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0003   -9.1989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0925  -10.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8925  -10.1771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2984   -9.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7492   -8.8627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1108   -9.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5937  -10.0385    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4403   -8.6314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4060   -9.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9569  -10.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7022  -10.2163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8136   -9.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6100   -9.4009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0119   -8.6940    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4638   -8.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7233   -8.4292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8240   -8.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8 11  1  0
 10  9  1  0
  9  7  1  0
  2  7  1  0
 11 10  1  0
 12 11  1  0
 10 12  1  0
 13 14  3  0
  1 13  1  0
  6 15  1  0
  5 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 17  1  0
 20 22  1  0
 22 23  1  0
 22 24  2  0
 25 23  1  1
 25 26  1  0
 26 27  1  0
 27 29  1  0
 28 25  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 28  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875151

    ---

Associated Targets(Human)

KLKB1 Tclin Plasma kallikrein (2047 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 441.54Molecular Weight (Monoisotopic): 441.2277AlogP: 2.72#Rotatable Bonds: 5
Polar Surface Area: 91.77Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.59CX LogP: 2.34CX LogD: 2.33
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.66Np Likeness Score: -1.09

References

1. Sabnis RW..  (2021)  Novel Heteroaromatic Carboxamide Derivatives as Plasma Kallikrein Inhibitors for Treating Diabetic Complications, Ocular Diseases and Edema-Associated Diseases.,  12  (12.0): [PMID:34917251] [10.1021/acsmedchemlett.1c00622]

Source