The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
benzo[d][1,3]dioxol-5-yl 6-(benzo[d][1,3]dioxol-5-yloxy)hexanoate ID: ALA4875152
PubChem CID: 155681721
Max Phase: Preclinical
Molecular Formula: C20H20O7
Molecular Weight: 372.37
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCCCOc1ccc2c(c1)OCO2)Oc1ccc2c(c1)OCO2
Standard InChI: InChI=1S/C20H20O7/c21-20(27-15-6-8-17-19(11-15)26-13-24-17)4-2-1-3-9-22-14-5-7-16-18(10-14)25-12-23-16/h5-8,10-11H,1-4,9,12-13H2
Standard InChI Key: YFDJEKICFHKHBH-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 30 0 0 0 0 0 0 0 0999 V2000
18.7332 -5.1823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4470 -4.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4442 -3.9420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7314 -3.5367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0210 -4.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0177 -3.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2360 -3.6994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7587 -4.3661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2414 -5.0288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1545 -3.5307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8678 -3.9367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5781 -3.5254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2915 -3.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9977 -3.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7110 -3.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4213 -3.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1347 -3.9207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4182 -2.6934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8450 -3.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5567 -3.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5455 -2.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8386 -2.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2639 -2.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2655 -3.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0460 -3.7556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5243 -3.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0434 -2.4274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
3 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 2 0
20 24 1 0
23 21 1 0
21 22 2 0
22 19 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 27 1 0
27 23 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 372.37Molecular Weight (Monoisotopic): 372.1209AlogP: 3.69#Rotatable Bonds: 8Polar Surface Area: 72.45Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.76CX LogD: 3.76Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.40Np Likeness Score: -0.10
References 1. Xie YD, Xu YH, Liu JP, Wang B, Shi YH, Wang W, Wang XP, Sun M, Xu XY, Bian XL.. (2021) 1,3-Benzodioxole-based fibrate derivatives as potential hypolipidemic and hepatoprotective agents., 43 [PMID:33684440 ] [10.1016/j.bmcl.2021.127898 ]