benzo[d][1,3]dioxol-5-yl 6-(benzo[d][1,3]dioxol-5-yloxy)hexanoate

ID: ALA4875152

PubChem CID: 155681721

Max Phase: Preclinical

Molecular Formula: C20H20O7

Molecular Weight: 372.37

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCCCCOc1ccc2c(c1)OCO2)Oc1ccc2c(c1)OCO2

Standard InChI:  InChI=1S/C20H20O7/c21-20(27-15-6-8-17-19(11-15)26-13-24-17)4-2-1-3-9-22-14-5-7-16-18(10-14)25-12-23-16/h5-8,10-11H,1-4,9,12-13H2

Standard InChI Key:  YFDJEKICFHKHBH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   18.7332   -5.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4470   -4.7688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4442   -3.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7314   -3.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0210   -4.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0177   -3.9486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2360   -3.6994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7587   -4.3661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2414   -5.0288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1545   -3.5307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8678   -3.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5781   -3.5254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2915   -3.9313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9977   -3.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7110   -3.9260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4213   -3.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1347   -3.9207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.4182   -2.6934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.8450   -3.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5567   -3.9179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5455   -2.2752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8386   -2.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2639   -2.6851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2655   -3.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0460   -3.7556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5243   -3.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0434   -2.4274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  3 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  2  0
 20 24  1  0
 23 21  1  0
 21 22  2  0
 22 19  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875152

    ---

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 372.37Molecular Weight (Monoisotopic): 372.1209AlogP: 3.69#Rotatable Bonds: 8
Polar Surface Area: 72.45Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.76CX LogD: 3.76
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.40Np Likeness Score: -0.10

References

1. Xie YD, Xu YH, Liu JP, Wang B, Shi YH, Wang W, Wang XP, Sun M, Xu XY, Bian XL..  (2021)  1,3-Benzodioxole-based fibrate derivatives as potential hypolipidemic and hepatoprotective agents.,  43  [PMID:33684440] [10.1016/j.bmcl.2021.127898]

Source