Benzhydryl spiro[penicillanate-6,3'-(5-ethoxycarbonyl-3H-pyrazole)]

ID: ALA4875160

PubChem CID: 164629063

Max Phase: Preclinical

Molecular Formula: C26H25N3O5S

Molecular Weight: 491.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=CC2(N=N1)C(=O)N1[C@@H](C(=O)OC(c3ccccc3)c3ccccc3)C(C)(C)S[C@@H]12

Standard InChI:  InChI=1S/C26H25N3O5S/c1-4-33-21(30)18-15-26(28-27-18)23(32)29-20(25(2,3)35-24(26)29)22(31)34-19(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-15,19-20,24H,4H2,1-3H3/t20-,24+,26?/m0/s1

Standard InChI Key:  MPGZLJJQSIWXGZ-YNHNLWNQSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    4.2791   -3.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2750   -3.1121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4891   -2.8610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0074   -3.5310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4957   -4.1958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0915   -3.9249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3791   -4.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0961   -4.7503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2833   -4.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1082   -3.9374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1127   -4.7624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8987   -5.0131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8914   -3.6782    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.0999   -3.1083    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1587   -5.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6105   -6.4126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9667   -5.9623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2266   -6.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0346   -6.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6785   -7.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8735   -7.1939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3256   -7.8097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5855   -8.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3982   -8.7582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9425   -8.1411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2898   -7.6937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0970   -7.8603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6460   -7.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3822   -6.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5756   -6.2943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6998   -5.3457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2302   -2.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7791   -1.4619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4224   -1.9102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1635   -1.1269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3557   -0.9595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  7  6  1  0
  7  8  1  0
  1  9  1  0
  9 11  1  0
 10  1  1  0
 10 11  1  0
 11 12  1  0
 12  7  1  0
  7 13  1  0
 13 10  1  0
 10 14  1  6
 12 15  1  6
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 19 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 19  1  0
  9 31  2  0
  3 32  1  0
 32 33  2  0
 32 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875160

    ---

Associated Targets(Human)

TZM (838 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.57Molecular Weight (Monoisotopic): 491.1515AlogP: 4.03#Rotatable Bonds: 6
Polar Surface Area: 97.63Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.34CX LogD: 4.34
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.45Np Likeness Score: -0.01

References

1. Alves NG, Bártolo I, Alves AJS, Fontinha D, Francisco D, Lopes SMM, Soares MIL, Simões CJV, Prudêncio M, Taveira N, Pinho E Melo TMVD..  (2021)  Synthesis and structure-activity relationships of new chiral spiro-β-lactams highly active against HIV-1 and Plasmodium.,  219  [PMID:33887681] [10.1016/j.ejmech.2021.113439]

Source