2-(2,6-difluorophenyl)-N-((2-(4-methylpiperidin-1-yl)-6-(trifluoromethyl)pyridin-3-yl)methyl)propanamide

ID: ALA4875167

PubChem CID: 164629068

Max Phase: Preclinical

Molecular Formula: C22H24F5N3O

Molecular Weight: 441.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1CCN(c2nc(C(F)(F)F)ccc2CNC(=O)C(C)c2c(F)cccc2F)CC1

Standard InChI:  InChI=1S/C22H24F5N3O/c1-13-8-10-30(11-9-13)20-15(6-7-18(29-20)22(25,26)27)12-28-21(31)14(2)19-16(23)4-3-5-17(19)24/h3-7,13-14H,8-12H2,1-2H3,(H,28,31)

Standard InChI Key:  FMFPUNREURIEIT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   39.2640   -9.0289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2628   -9.8562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.9776  -10.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6940   -9.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6912   -9.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9758   -8.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9774  -11.0941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2616  -11.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2594  -12.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9720  -12.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6883  -12.3269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6922  -11.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9686  -13.5629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4091  -10.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1230   -9.8535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.8380  -10.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5518   -9.8512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8393  -11.0898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.2669  -10.2626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2638  -11.0882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9780  -11.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6928  -11.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6889  -10.2567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9741   -9.8491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9695   -9.0241    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   43.5488  -11.4998    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   43.5505   -9.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5494   -8.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5492   -7.7915    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.8351   -9.0292    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.8321   -8.2039    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 24 25  1  0
 20 26  1  0
 17 27  1  0
  1 28  1  0
 28 29  1  0
 28 30  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875167

    ---

Associated Targets(Human)

TRPV1 Tclin Vanilloid receptor (8273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 441.44Molecular Weight (Monoisotopic): 441.1840AlogP: 5.03#Rotatable Bonds: 5
Polar Surface Area: 45.23Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.83CX Basic pKa: 2.51CX LogP: 5.47CX LogD: 5.47
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.48

References

1. Kang JM, Kwon SO, Ann J, Lee S, Kim C, Do N, Jeong JJ, Blumberg PM, Ha H, Vu TNL, Yoon S, Choi S, Frank-Foltyn R, Lesch B, Bahrenberg G, Stockhausen H, Christoph T, Lee J..  (2021)  2-(Halogenated Phenyl) acetamides and propanamides as potent TRPV1 antagonists.,  48  [PMID:34273488] [10.1016/j.bmcl.2021.128266]

Source