The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,6-difluorophenyl)-N-((2-(4-methylpiperidin-1-yl)-6-(trifluoromethyl)pyridin-3-yl)methyl)propanamide ID: ALA4875167
PubChem CID: 164629068
Max Phase: Preclinical
Molecular Formula: C22H24F5N3O
Molecular Weight: 441.44
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1CCN(c2nc(C(F)(F)F)ccc2CNC(=O)C(C)c2c(F)cccc2F)CC1
Standard InChI: InChI=1S/C22H24F5N3O/c1-13-8-10-30(11-9-13)20-15(6-7-18(29-20)22(25,26)27)12-28-21(31)14(2)19-16(23)4-3-5-17(19)24/h3-7,13-14H,8-12H2,1-2H3,(H,28,31)
Standard InChI Key: FMFPUNREURIEIT-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
39.2640 -9.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2628 -9.8562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9776 -10.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6940 -9.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6912 -9.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9758 -8.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9774 -11.0941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2616 -11.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2594 -12.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9720 -12.7380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6883 -12.3269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6922 -11.4994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9686 -13.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4091 -10.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1230 -9.8535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.8380 -10.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5518 -9.8512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8393 -11.0898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.2669 -10.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2638 -11.0882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9780 -11.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6928 -11.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6889 -10.2567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9741 -9.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9695 -9.0241 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
43.5488 -11.4998 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
43.5505 -9.0262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5494 -8.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5492 -7.7915 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.8351 -9.0292 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.8321 -8.2039 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
10 13 1 0
4 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
24 25 1 0
20 26 1 0
17 27 1 0
1 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.44Molecular Weight (Monoisotopic): 441.1840AlogP: 5.03#Rotatable Bonds: 5Polar Surface Area: 45.23Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.83CX Basic pKa: 2.51CX LogP: 5.47CX LogD: 5.47Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.48
References 1. Kang JM, Kwon SO, Ann J, Lee S, Kim C, Do N, Jeong JJ, Blumberg PM, Ha H, Vu TNL, Yoon S, Choi S, Frank-Foltyn R, Lesch B, Bahrenberg G, Stockhausen H, Christoph T, Lee J.. (2021) 2-(Halogenated Phenyl) acetamides and propanamides as potent TRPV1 antagonists., 48 [PMID:34273488 ] [10.1016/j.bmcl.2021.128266 ]