(1R,5S,6R)-N-((S)-1-(imidazo[1,2-a]pyrazin-8-yl)pyrrolidin-3-yl)-3-((R)-2-methylpyrrolidine-1-carbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxamide

ID: ALA4875191

PubChem CID: 164626136

Max Phase: Preclinical

Molecular Formula: C22H29N7O2

Molecular Weight: 423.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]1CCCN1C(=O)N1C[C@@H]2[C@H](C1)[C@H]2C(=O)N[C@H]1CCN(c2nccn3ccnc23)C1

Standard InChI:  InChI=1S/C22H29N7O2/c1-14-3-2-7-29(14)22(31)28-12-16-17(13-28)18(16)21(30)25-15-4-8-27(11-15)20-19-23-5-9-26(19)10-6-24-20/h5-6,9-10,14-18H,2-4,7-8,11-13H2,1H3,(H,25,30)/t14-,15+,16-,17+,18+/m1/s1

Standard InChI Key:  PTASFCFUSDLTGY-WKULXVSPSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   30.8056  -19.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6228  -19.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8772  -18.4232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2142  -17.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5555  -18.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6456  -18.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2485  -18.7218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0232  -18.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1984  -17.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5925  -17.1251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8114  -17.3739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5943  -16.3133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8227  -16.0608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3443  -16.7165    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7781  -18.1710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.1711  -18.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3938  -18.4659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3414  -19.5173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.5952  -18.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8481  -17.8615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1857  -17.3804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5235  -17.8617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7767  -18.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4242  -17.2766    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.8051  -19.4269    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.7462  -17.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5762  -16.8100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1391  -18.1563    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3397  -17.9872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9313  -18.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4783  -19.3022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2247  -18.9696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9325  -19.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  3  6  1  0
  6  7  2  0
  6 11  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 11  2  0
  5 15  1  6
 15 16  1  0
 17 16  1  1
 16 18  2  0
 20 17  1  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 20 24  1  1
 19 25  1  1
 22 26  1  0
 26 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 28  1  0
 32 33  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4875191

    ---

Associated Targets(Human)

ACKR3 Tchem C-X-C chemokine receptor type 7 (1102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.52Molecular Weight (Monoisotopic): 423.2383AlogP: 1.21#Rotatable Bonds: 3
Polar Surface Area: 86.08Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.65CX LogP: -0.76CX LogD: -0.76
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.80Np Likeness Score: -1.23

References

1. Aspnes GE, Menhaji-Klotz E, Boehm M, Londregan AT, Lee ECY, Limberakis C, Coffey SB, Brown JA, Jones RM, Hesp KD..  (2021)  Discovery and evaluation of non-basic small molecule modulators of the atypical chemokine receptor CXCR7.,  50  [PMID:34400299] [10.1016/j.bmcl.2021.128320]

Source