1-(2-chlorophenyl)-3-(4-(4-chlorophenyl)thiazol-2-yl)-7,7-dimethyl-7,8-dihydroquinoline-2,5(1H,6H)-dione

ID: ALA4875194

PubChem CID: 137548554

Max Phase: Preclinical

Molecular Formula: C26H20Cl2N2O2S

Molecular Weight: 495.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(C)CC(=O)c2cc(-c3nc(-c4ccc(Cl)cc4)cs3)c(=O)n(-c3ccccc3Cl)c2C1

Standard InChI:  InChI=1S/C26H20Cl2N2O2S/c1-26(2)12-22-17(23(31)13-26)11-18(25(32)30(22)21-6-4-3-5-19(21)28)24-29-20(14-33-24)15-7-9-16(27)10-8-15/h3-11,14H,12-13H2,1-2H3

Standard InChI Key:  JKEHALIZOPCDAV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   25.4500  -19.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8667  -19.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0414  -19.1121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8667  -18.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5787  -19.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5787  -17.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2908  -18.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2872  -19.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9960  -19.5299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.7128  -19.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7164  -18.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0030  -17.8800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5787  -17.0500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4250  -19.5393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9915  -20.3536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2731  -20.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2680  -21.5856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9807  -22.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6999  -21.5901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7014  -20.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4298  -17.8858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1817  -18.2253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7370  -17.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3282  -16.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5204  -17.0659    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.5563  -17.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8872  -18.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7063  -18.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1957  -17.8868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8600  -17.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0417  -17.0413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0158  -17.9763    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   29.4170  -20.3568    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  2  1  0
  4  6  1  0
  2  5  1  0
  5  8  1  0
  7  6  1  0
  7  8  2  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
  6 13  2  0
 10 14  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  9 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
 11 21  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 23 26  1  0
 29 32  1  0
 20 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875194

    ---

Associated Targets(Human)

IDH1 Tclin Isocitrate dehydrogenase [NADP] cytoplasmic (40980 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 495.43Molecular Weight (Monoisotopic): 494.0623AlogP: 7.09#Rotatable Bonds: 3
Polar Surface Area: 51.96Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.71CX LogD: 6.71
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.30Np Likeness Score: -1.18

References

1. Rohde JM, Karavadhi S, Pragani R, Liu L, Fang Y, Zhang W, McIver A, Zheng H, Liu Q, Davis MI, Urban DJ, Lee TD, Cheff DM, Hollingshead M, Henderson MJ, Martinez NJ, Brimacombe KR, Yasgar A, Zhao W, Klumpp-Thomas C, Michael S, Covey J, Moore WJ, Stott GM, Li Z, Simeonov A, Jadhav A, Frye S, Hall MD, Shen M, Wang X, Patnaik S, Boxer MB..  (2021)  Discovery and Optimization of 2H-1λ2-Pyridin-2-one Inhibitors of Mutant Isocitrate Dehydrogenase 1 for the Treatment of Cancer.,  64  (8.0): [PMID:33822623] [10.1021/acs.jmedchem.1c00019]

Source