8-((4-(4-Fluorobenzyl)piperazin-1-yl)methyl)-5,7-dihydroxy-2-(4-hydroxyphen-yl)-4H-chromen-4-one

ID: ALA4875196

PubChem CID: 164626318

Max Phase: Preclinical

Molecular Formula: C27H25FN2O5

Molecular Weight: 476.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1cc(-c2ccc(O)cc2)oc2c(CN3CCN(Cc4ccc(F)cc4)CC3)c(O)cc(O)c12

Standard InChI:  InChI=1S/C27H25FN2O5/c28-19-5-1-17(2-6-19)15-29-9-11-30(12-10-29)16-21-22(32)13-23(33)26-24(34)14-25(35-27(21)26)18-3-7-20(31)8-4-18/h1-8,13-14,31-33H,9-12,15-16H2

Standard InChI Key:  YNPSZYHSMIFIMD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   34.5724   -4.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5713   -5.1378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2858   -5.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2840   -3.8982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9990   -4.3071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9979   -5.1398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7145   -5.5550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4369   -5.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4381   -4.3092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7169   -3.8895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.8581   -3.8986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2855   -6.3751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.7121   -6.3797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2815   -3.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5661   -2.6633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5662   -1.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8550   -1.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1396   -1.8360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.1400   -2.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8559   -3.0762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4257   -1.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7111   -1.8347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1516   -3.9012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8651   -4.3170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5797   -3.9072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5822   -3.0816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8639   -2.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1522   -3.0799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2968   -2.6700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9989   -1.4221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2864   -1.8304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2816   -2.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9952   -3.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7139   -2.6605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5655   -3.0644    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  1 11  1  0
  3 12  1  0
  7 13  2  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  9 23  1  0
 26 29  1  0
 22 30  2  0
 22 34  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875196

    ---

Associated Targets(Human)

PARP1 Tclin Poly [ADP-ribose] polymerase-1 (6206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PARP2 Tclin Poly [ADP-ribose] polymerase 2 (1185 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.50Molecular Weight (Monoisotopic): 476.1748AlogP: 4.03#Rotatable Bonds: 5
Polar Surface Area: 97.38Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 5.52CX Basic pKa: 6.66CX LogP: 3.45CX LogD: 2.82
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: 0.12

References

1. Long H, Hu X, Wang B, Wang Q, Wang R, Liu S, Xiong F, Jiang Z, Zhang XQ, Ye WC, Wang H..  (2021)  Discovery of Novel Apigenin-Piperazine Hybrids as Potent and Selective Poly (ADP-Ribose) Polymerase-1 (PARP-1) Inhibitors for the Treatment of Cancer.,  64  (16.0): [PMID:34404206] [10.1021/acs.jmedchem.1c00735]

Source