The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-((4-(4-Fluorobenzyl)piperazin-1-yl)methyl)-5,7-dihydroxy-2-(4-hydroxyphen-yl)-4H-chromen-4-one ID: ALA4875196
PubChem CID: 164626318
Max Phase: Preclinical
Molecular Formula: C27H25FN2O5
Molecular Weight: 476.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1cc(-c2ccc(O)cc2)oc2c(CN3CCN(Cc4ccc(F)cc4)CC3)c(O)cc(O)c12
Standard InChI: InChI=1S/C27H25FN2O5/c28-19-5-1-17(2-6-19)15-29-9-11-30(12-10-29)16-21-22(32)13-23(33)26-24(34)14-25(35-27(21)26)18-3-7-20(31)8-4-18/h1-8,13-14,31-33H,9-12,15-16H2
Standard InChI Key: YNPSZYHSMIFIMD-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
34.5724 -4.3107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5713 -5.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2858 -5.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2840 -3.8982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9990 -4.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9979 -5.1398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7145 -5.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4369 -5.1420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4381 -4.3092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7169 -3.8895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8581 -3.8986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2855 -6.3751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7121 -6.3797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2815 -3.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5661 -2.6633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5662 -1.8351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8550 -1.4249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1396 -1.8360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1400 -2.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8559 -3.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4257 -1.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7111 -1.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1516 -3.9012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8651 -4.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5797 -3.9072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5822 -3.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8639 -2.6676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1522 -3.0799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2968 -2.6700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9989 -1.4221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2864 -1.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2816 -2.6554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9952 -3.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7139 -2.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5655 -3.0644 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
1 11 1 0
3 12 1 0
7 13 2 0
4 14 1 0
14 15 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
18 21 1 0
21 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
9 23 1 0
26 29 1 0
22 30 2 0
22 34 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.50Molecular Weight (Monoisotopic): 476.1748AlogP: 4.03#Rotatable Bonds: 5Polar Surface Area: 97.38Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.52CX Basic pKa: 6.66CX LogP: 3.45CX LogD: 2.82Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: 0.12
References 1. Long H, Hu X, Wang B, Wang Q, Wang R, Liu S, Xiong F, Jiang Z, Zhang XQ, Ye WC, Wang H.. (2021) Discovery of Novel Apigenin-Piperazine Hybrids as Potent and Selective Poly (ADP-Ribose) Polymerase-1 (PARP-1) Inhibitors for the Treatment of Cancer., 64 (16.0): [PMID:34404206 ] [10.1021/acs.jmedchem.1c00735 ]