(E)-3-(1H-benzo[d]imidazol-2-yl)-4-(3-ethoxy-4-(2-oxo-2-(phenylamino)ethoxy)phenyl)but-3-enoic acid

ID: ALA4875229

PubChem CID: 164627396

Max Phase: Preclinical

Molecular Formula: C27H25N3O5

Molecular Weight: 471.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1cc(/C=C(\CC(=O)O)c2nc3ccccc3[nH]2)ccc1OCC(=O)Nc1ccccc1

Standard InChI:  InChI=1S/C27H25N3O5/c1-2-34-24-15-18(12-13-23(24)35-17-25(31)28-20-8-4-3-5-9-20)14-19(16-26(32)33)27-29-21-10-6-7-11-22(21)30-27/h3-15H,2,16-17H2,1H3,(H,28,31)(H,29,30)(H,32,33)/b19-14+

Standard InChI Key:  URVGICCCRMJDNU-XMHGGMMESA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    1.3977   -4.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3966   -5.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1046   -5.7767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1028   -4.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8114   -4.5446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8117   -5.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5904   -5.6160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0714   -4.9535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5899   -4.2914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8886   -4.9532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2974   -5.6607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2969   -4.2453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1141   -4.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5185   -4.9538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3350   -4.9538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7441   -4.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3309   -3.5355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5158   -3.5390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8891   -6.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2979   -7.0762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0719   -6.3689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7367   -2.8263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5539   -2.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9597   -2.1138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5613   -4.2441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9687   -3.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7859   -3.5343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1933   -2.8259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0105   -2.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1957   -4.2413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4185   -3.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2350   -3.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6432   -2.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2290   -2.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4139   -2.1173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 11 19  1  0
 19 20  2  0
 19 21  1  0
 17 22  1  0
 22 23  1  0
 23 24  1  0
 16 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  2  0
 29 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875229

    ---

Associated Targets(Human)

GLO1 Tchem Glyoxalase I (402 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H522 (44358 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.51Molecular Weight (Monoisotopic): 471.1794AlogP: 4.99#Rotatable Bonds: 10
Polar Surface Area: 113.54Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.75CX Basic pKa: 5.23CX LogP: 3.07CX LogD: 1.21
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -1.01

References

1. Azuma M, Inoue M, Nishida A, Akahane H, Kitajima M, Natani S, Chimori R, Yoshimori A, Mano Y, Uchiro H, Tanuma SI, Takasawa R..  (2021)  Addition of hydrophobic side chains improve the apoptosis inducibility of the human glyoxalase I inhibitor, TLSC702.,  40  [PMID:33711442] [10.1016/j.bmcl.2021.127918]

Source