The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-chloro-4-methylthiophen-3-yl)-2-(2-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-ylamino)thiazole-5-carboxamide ID: ALA4875238
PubChem CID: 153569033
Max Phase: Preclinical
Molecular Formula: C19H22ClN7OS2
Molecular Weight: 464.02
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(Nc2ncc(C(=O)Nc3c(C)csc3Cl)s2)cc(N2CCN(C)CC2)n1
Standard InChI: InChI=1S/C19H22ClN7OS2/c1-11-10-29-17(20)16(11)25-18(28)13-9-21-19(30-13)24-14-8-15(23-12(2)22-14)27-6-4-26(3)5-7-27/h8-10H,4-7H2,1-3H3,(H,25,28)(H,21,22,23,24)
Standard InChI Key: DFZKXFCZKLBBRG-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
15.9668 -17.7924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9657 -18.6120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6737 -19.0209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3834 -18.6115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3806 -17.7888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6719 -17.3836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6741 -19.8332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9645 -20.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9623 -21.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6681 -21.4666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3777 -21.0594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3815 -20.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2590 -17.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6648 -22.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0867 -17.3776 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7960 -17.7835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8836 -18.5953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6836 -18.7622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0895 -18.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5404 -17.4478 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.9019 -17.9644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3848 -18.6236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1972 -18.5351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2314 -17.2165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7453 -19.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4906 -18.8045 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.4020 -17.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6021 -17.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5783 -19.9397 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
22.2663 -17.0803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
3 7 1 0
1 13 1 0
10 14 1 0
5 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 1 0
19 21 1 0
21 22 1 0
22 23 1 0
21 24 2 0
23 25 2 0
25 26 1 0
26 27 1 0
27 28 2 0
28 23 1 0
25 29 1 0
28 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.02Molecular Weight (Monoisotopic): 463.1016AlogP: 4.01#Rotatable Bonds: 5Polar Surface Area: 86.28Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.52CX Basic pKa: 7.33CX LogP: 4.24CX LogD: 4.13Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -2.22
References 1. (2020) Heterocyclic kinase inhibitors and uses thereof,