The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5R,9R)-11-ethylidene-5-((6-methoxynaphthalen-2-yl)amino)-7-methyl-5,6,9,10-tetrahydro-5,9-methanocycloocta[b]pyridin-2(1H)-one ID: ALA4875252
PubChem CID: 164627646
Max Phase: Preclinical
Molecular Formula: C26H26N2O2
Molecular Weight: 398.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C1\[C@H]2C=C(C)C[C@]1(Nc1ccc3cc(OC)ccc3c1)c1ccc(=O)[nH]c1C2
Standard InChI: InChI=1S/C26H26N2O2/c1-4-22-19-11-16(2)15-26(22,23-9-10-25(29)27-24(23)14-19)28-20-7-5-18-13-21(30-3)8-6-17(18)12-20/h4-13,19,28H,14-15H2,1-3H3,(H,27,29)/b22-4+/t19-,26+/m0/s1
Standard InChI Key: VAZOKHMFZPAYCS-SQYFZTEWSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
18.6469 -8.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5628 -8.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6924 -8.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0949 -9.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2203 -8.6062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4409 -7.8619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1942 -9.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1702 -7.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1864 -8.5895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0724 -8.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5758 -8.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9898 -7.4312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9470 -9.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0568 -9.6935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6767 -10.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8544 -8.0752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3996 -6.7077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8403 -10.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3840 -8.6021 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.7718 -10.1075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7681 -10.9350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1977 -10.1059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4829 -9.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1994 -10.9365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4822 -11.3464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4796 -12.1706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1935 -12.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9114 -12.1709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9104 -11.3481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6288 -12.5843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6295 -13.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 1 1 0
5 4 1 0
6 3 1 0
7 2 1 0
8 12 2 0
9 5 1 0
10 13 1 0
11 1 1 0
12 11 1 0
13 7 2 0
1 14 1 1
15 4 2 0
16 10 2 0
17 12 1 0
18 15 1 0
5 19 1 6
5 8 1 0
3 9 1 0
6 10 1 0
14 20 1 0
20 21 2 0
21 25 1 0
24 22 1 0
22 23 2 0
23 20 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 24 2 0
28 30 1 0
30 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 398.51Molecular Weight (Monoisotopic): 398.1994AlogP: 5.31#Rotatable Bonds: 3Polar Surface Area: 54.12Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.06CX Basic pKa: 3.41CX LogP: 3.52CX LogD: 3.52Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: 0.72
References 1. Miao SX, Wan LX, He ZX, Zhou XL, Li X, Gao F.. (2021) Pd-Catalyzed Direct Diversification of Natural Anti-Alzheimer's Disease Drug: Synthesis and Biological Evaluation of N -Aryl Huperzine A Analogues., 84 (8.0): [PMID:34445873 ] [10.1021/acs.jnatprod.1c00600 ]