((S)-piperidin-3-yl)methyl ((2S,3R)-3-hydroxy-4-(N-isobutyl-4-methoxyphenylsulfonamido)-1-phenylbutan-2-yl)carbamate

ID: ALA4875282

PubChem CID: 164627911

Max Phase: Preclinical

Molecular Formula: C28H41N3O6S

Molecular Weight: 547.72

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC[C@H]2CCCNC2)cc1

Standard InChI:  InChI=1S/C28H41N3O6S/c1-21(2)18-31(38(34,35)25-13-11-24(36-3)12-14-25)19-27(32)26(16-22-8-5-4-6-9-22)30-28(33)37-20-23-10-7-15-29-17-23/h4-6,8-9,11-14,21,23,26-27,29,32H,7,10,15-20H2,1-3H3,(H,30,33)/t23-,26-,27+/m0/s1

Standard InChI Key:  SGEXQIUVSGWABP-MSLLRLGPSA-N

Molfile:  

 
     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
    8.3081  -10.3717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7208  -11.0816    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.1292  -10.3692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4555  -11.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4579  -10.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1620  -11.4820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8750  -11.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5856  -11.4861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8774  -10.2541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5904   -9.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3009  -10.2605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0135   -9.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0163   -9.0284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3007   -8.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5911   -9.0261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5833  -12.3074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2987  -11.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0093  -11.4903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0069  -12.3116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4330  -11.4944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4256  -12.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1354  -12.7314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8453  -12.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8450  -11.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1388  -11.0883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5941  -13.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7769  -13.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9987  -13.7273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5532  -12.7289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5537  -13.5461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7466  -11.4778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0401  -11.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3312  -11.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6244  -11.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9176  -11.4646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9110  -12.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6174  -12.6949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3303  -12.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  1
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 16  1  1
  8 17  1  0
 17 18  1  0
 18 19  1  0
 18  2  1  0
  2 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 19 26  1  0
 26 27  1  0
 26 28  1  0
 23 29  1  0
 29 30  1  0
  4 31  1  0
 31 32  1  0
 33 32  1  1
 33 34  1  0
 33 38  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4875282

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 547.72

Molecular Weight (Monoisotopic): 547.2716

AlogP: 3.04

#Rotatable Bonds: 13

Polar Surface Area: 117.20

Molecular Species: BASE

HBA: 7

HBD: 3

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 13.64

CX Basic pKa: 9.97

CX LogP: 3.34

CX LogD: 0.86

Aromatic Rings: 2

Heavy Atoms: 38

QED Weighted: 0.35

Np Likeness Score: -0.46

References

1. Zhu M, Zhou H, Ma L, Dong B, Zhou J, Zhang G, Wang M, Wang J, Cen S, Wang Y..  (2021)  Design and evaluation of novel piperidine HIV-1 protease inhibitors with potency against DRV-resistant variants.,  220  [PMID:33906049] [10.1016/j.ejmech.2021.113450]

Source

Source(1):

• Scientific Literature