1-(2-fluoro-4-nitro-5-(4-(phenylsulfonyl)piperazin-1-yl)phenyl)azepane

ID: ALA4875290

PubChem CID: 2913873

Max Phase: Preclinical

Molecular Formula: C22H27FN4O4S

Molecular Weight: 462.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])c1cc(F)c(N2CCCCCC2)cc1N1CCN(S(=O)(=O)c2ccccc2)CC1

Standard InChI:  InChI=1S/C22H27FN4O4S/c23-19-16-22(27(28)29)21(17-20(19)24-10-6-1-2-7-11-24)25-12-14-26(15-13-25)32(30,31)18-8-4-3-5-9-18/h3-5,8-9,16-17H,1-2,6-7,10-15H2

Standard InChI Key:  PHTDYGXLLYTXFY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   33.4471   -5.3241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.0426   -4.6184    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.6336   -5.3215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8025   -2.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8014   -2.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5094   -3.3953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2191   -2.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2162   -2.1632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5076   -1.7579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0969   -3.3921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9251   -3.3925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9244   -4.2107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6287   -4.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3382   -4.2118    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3389   -3.3937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6301   -2.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9245   -1.7505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9215   -0.9334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6338   -2.1565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0947   -1.7583    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.7536   -4.2150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4585   -4.6285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1666   -4.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1688   -3.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4571   -2.9941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7519   -3.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1527   -4.1978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5560   -4.7527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4207   -2.9317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7528   -4.6357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6428   -3.1727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3485   -3.9316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  7 11  1  0
 17 18  2  0
 17 19  1  0
  8 17  1  0
  4 20  1  0
 14  2  1  0
  2 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 10 27  1  0
 27 28  1  0
 10 29  1  0
 28 30  1  0
 29 31  1  0
 30 32  1  0
 31 32  1  0
M  CHG  2  17   1  19  -1
M  END

Associated Targets(Human)

GPR174 Tchem Probable G-protein coupled receptor 174 (370 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.55Molecular Weight (Monoisotopic): 462.1737AlogP: 3.63#Rotatable Bonds: 5
Polar Surface Area: 87.00Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.25CX LogD: 4.25
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -1.82

References

1.  (2020)  Methods and Compositions for Treating Cancer, 

Source