4-(6-(2-fluoro-4-methylphenyl)-3-((pyrrolidin-3-ylamino)methyl)benzofuran-5-yl)benzonitrile

ID: ALA4875303

PubChem CID: 164628464

Max Phase: Preclinical

Molecular Formula: C27H24FN3O

Molecular Weight: 425.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2cc3occ(CNC4CCNC4)c3cc2-c2ccc(C#N)cc2)c(F)c1

Standard InChI:  InChI=1S/C27H24FN3O/c1-17-2-7-22(26(28)10-17)25-12-27-24(11-23(25)19-5-3-18(13-29)4-6-19)20(16-32-27)14-31-21-8-9-30-15-21/h2-7,10-12,16,21,30-31H,8-9,14-15H2,1H3

Standard InChI Key:  YSBGZDHINUNSJV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   38.3034  -11.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3022  -12.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0103  -12.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7200  -12.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7171  -11.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0085  -10.9203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5945  -10.9151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8867  -10.5066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4248  -12.5550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4247  -13.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1323  -13.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1283  -12.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8364  -12.5495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8388  -13.3681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6181  -13.6187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.0973  -12.9550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6141  -12.2943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8643  -11.5164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6631  -11.3440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.7197  -13.7810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0115  -13.3711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3045  -13.7794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7215  -14.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9133  -10.5661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6871  -10.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6846   -9.4992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.9066   -9.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4284   -9.9116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0174  -15.0055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3067  -14.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5997  -15.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4305  -15.0011    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  3  0
  1  7  1  0
  9 10  2  0
 10 11  1  0
 11 14  2  0
 13 12  2  0
 12  9  1  0
  4  9  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 13  1  0
 17 18  1  0
 18 19  1  0
 20 21  2  0
 21 22  1  0
 22 30  2  0
 29 23  2  0
 23 20  1  0
 10 20  1  0
 19 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
 29 30  1  0
 30 31  1  0
 23 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875303

    ---

Associated Targets(Human)

KDM1A Tchem Lysine-specific histone demethylase 1 (3916 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.51Molecular Weight (Monoisotopic): 425.1903AlogP: 5.54#Rotatable Bonds: 5
Polar Surface Area: 60.99Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.39CX LogP: 5.08CX LogD: 2.27
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.72

References

1. Zhang X, Huang H, Zhang Z, Yan J, Wu T, Yin W, Sun Y, Wang X, Gu Y, Zhao D, Cheng M..  (2021)  Design, synthesis and biological evaluation of novel benzofuran derivatives as potent LSD1 inhibitors.,  220  [PMID:33945992] [10.1016/j.ejmech.2021.113501]

Source