The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(3-fluorobenzyloxy)phenyl)-3-phenylisoxazolo[5,4-d]pyrimidin-4-amine ID: ALA4875336
PubChem CID: 163322894
Max Phase: Preclinical
Molecular Formula: C24H17FN4O2
Molecular Weight: 412.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Fc1cccc(COc2ccc(Nc3ncnc4onc(-c5ccccc5)c34)cc2)c1
Standard InChI: InChI=1S/C24H17FN4O2/c25-18-8-4-5-16(13-18)14-30-20-11-9-19(10-12-20)28-23-21-22(17-6-2-1-3-7-17)29-31-24(21)27-15-26-23/h1-13,15H,14H2,(H,26,27,28)
Standard InChI Key: PMWGHYURIDXSAI-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
26.8873 -15.5839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6043 -15.1702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6015 -14.3388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8855 -13.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1718 -15.1706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1684 -14.3455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3828 -14.0937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9003 -14.7632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3881 -15.4287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1254 -13.3119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6772 -12.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4195 -11.9124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6103 -11.7433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0594 -12.3641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3200 -13.1454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8827 -13.1036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5966 -12.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3112 -13.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0245 -12.6867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0223 -11.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3008 -11.4496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5905 -11.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7356 -11.4439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4525 -11.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1616 -11.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8754 -11.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5840 -11.4287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5782 -10.6056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8580 -10.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1525 -10.6181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3019 -11.8365 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
7 10 1 0
4 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
23 24 1 0
25 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
27 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.42Molecular Weight (Monoisotopic): 412.1336AlogP: 5.75#Rotatable Bonds: 6Polar Surface Area: 73.07Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.58CX LogD: 5.58Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.38Np Likeness Score: -1.60
References 1. Gaikwad NB, Bansod S, Mara A, Garise R, Srinivas N, Godugu C, Yaddanapudi VM.. (2021) Design, synthesis, and biological evaluation of N-(4-substituted)-3-phenylisoxazolo[5,4-d]pyrimidin-4-amine derivatives as apoptosis-inducing cytotoxic agents., 49 [PMID:34333139 ] [10.1016/j.bmcl.2021.128294 ]