2-(6-(1H-indol-3-yl)-1H-benzo[d][1,2,3]triazol-1-yl)acetamide

ID: ALA4875368

PubChem CID: 164626144

Max Phase: Preclinical

Molecular Formula: C16H13N5O

Molecular Weight: 291.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)Cn1nnc2cc(-c3c[nH]c4ccccc34)ccc21

Standard InChI:  InChI=1S/C16H13N5O/c17-16(22)9-21-15-6-5-10(7-14(15)19-20-21)12-8-18-13-4-2-1-3-11(12)13/h1-8,18H,9H2,(H2,17,22)

Standard InChI Key:  WWMNIVQWMHWOTB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 25  0  0  0  0  0  0  0  0999 V2000
   19.9166  -19.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9154  -20.0771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6235  -20.4861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6217  -18.8488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3303  -19.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3351  -20.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1151  -20.3211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5925  -19.6559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1074  -18.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3554  -18.2179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1555  -18.0481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0510  -16.8433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8067  -17.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8555  -16.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4006  -17.2679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1452  -16.9366    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0602  -16.1261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2631  -15.9566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.9309  -15.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4113  -14.5490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0791  -13.8024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2240  -14.6345    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 15  1  0
 14 12  1  0
 12 13  2  0
 13 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875368

    ---

Associated Targets(Human)

TDO2 Tchem Tryptophan 2,3-dioxygenase (1554 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 291.31Molecular Weight (Monoisotopic): 291.1120AlogP: 2.06#Rotatable Bonds: 3
Polar Surface Area: 89.59Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.36CX LogP: 1.84CX LogD: 1.84
Aromatic Rings: 4Heavy Atoms: 22QED Weighted: 0.61Np Likeness Score: -1.49

References

1. Kozlova A, Thabault L, Liberelle M, Klaessens S, Prévost JRC, Mathieu C, Pilotte L, Stroobant V, Van den Eynde B, Frédérick R..  (2021)  Rational Design of Original Fused-Cycle Selective Inhibitors of Tryptophan 2,3-Dioxygenase.,  64  (15.0): [PMID:34338527] [10.1021/acs.jmedchem.1c00323]

Source