The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]morpholine-4-carboxamide ID: ALA4875384
PubChem CID: 164626514
Max Phase: Preclinical
Molecular Formula: C25H31N3O6
Molecular Weight: 469.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNc1ccc2c(cc1=O)[C@@H](NC(=O)N1CCOCC1)CCc1cc(OC)c(OC)c(OC)c1-2
Standard InChI: InChI=1S/C25H31N3O6/c1-26-19-8-6-16-17(14-20(19)29)18(27-25(30)28-9-11-34-12-10-28)7-5-15-13-21(31-2)23(32-3)24(33-4)22(15)16/h6,8,13-14,18H,5,7,9-12H2,1-4H3,(H,26,29)(H,27,30)/t18-/m0/s1
Standard InChI Key: KKDGGLDTVULSEP-SFHVURJKSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
14.5677 -23.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5666 -24.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2705 -24.8816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2687 -23.2525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9766 -24.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9773 -23.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6192 -23.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4204 -23.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7735 -24.0578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6192 -24.9802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4227 -24.8008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0719 -25.3150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2585 -25.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0771 -26.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6221 -26.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4311 -26.6549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6147 -27.4471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0168 -28.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8102 -26.4942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5865 -24.0560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9936 -23.3474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8066 -23.3456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5834 -22.6448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2713 -25.6947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8627 -24.8807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8640 -23.2529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8638 -22.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1594 -24.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5682 -26.0999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2168 -24.0525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2137 -22.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0309 -22.6352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4410 -23.3420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0340 -24.0507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 5 2 0
6 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
5 10 1 0
7 8 1 0
8 9 1 0
11 9 1 0
10 11 1 0
11 12 2 0
10 13 2 0
12 14 1 0
13 15 1 0
14 16 1 0
15 16 2 0
16 17 1 0
17 18 1 0
14 19 2 0
9 20 1 6
20 21 1 0
21 22 1 0
21 23 2 0
3 24 1 0
2 25 1 0
1 26 1 0
26 27 1 0
25 28 1 0
24 29 1 0
22 30 1 0
22 31 1 0
31 32 1 0
30 34 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.54Molecular Weight (Monoisotopic): 469.2213AlogP: 2.81#Rotatable Bonds: 5Polar Surface Area: 98.36Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.80CX LogP: 1.04CX LogD: 1.04Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.69Np Likeness Score: -0.06
References 1. Krzywik J, Maj E, Nasulewicz-Goldeman A, Mozga W, Wietrzyk J, Huczyński A.. (2021) Synthesis and antiproliferative screening of novel doubly modified colchicines containing urea, thiourea and guanidine moieties., 47 [PMID:34116158 ] [10.1016/j.bmcl.2021.128197 ]