The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(1H-Indol-3-yl)-2-oxo-2-(phenethylamino)ethyl)-2-chloro-N-(4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl)acetamide ID: ALA4875408
PubChem CID: 164626793
Max Phase: Preclinical
Molecular Formula: C29H26ClN5O3
Molecular Weight: 528.01
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1noc(-c2ccc(N(C(=O)CCl)C(C(=O)NCCc3ccccc3)c3c[nH]c4ccccc34)cc2)n1
Standard InChI: InChI=1S/C29H26ClN5O3/c1-19-33-29(38-34-19)21-11-13-22(14-12-21)35(26(36)17-30)27(24-18-32-25-10-6-5-9-23(24)25)28(37)31-16-15-20-7-3-2-4-8-20/h2-14,18,27,32H,15-17H2,1H3,(H,31,37)
Standard InChI Key: JUFXXESEJSMBLP-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
31.8032 -23.7889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8021 -24.6162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5168 -25.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5151 -23.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2303 -23.7852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2352 -24.6162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0270 -24.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5115 -24.1932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0191 -23.5239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2842 -25.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7338 -26.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9902 -27.0450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7975 -27.2160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3481 -26.6005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0913 -25.8138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6402 -25.1980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0551 -27.9997 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
33.4403 -27.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9263 -26.0960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1553 -26.7699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4469 -25.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9957 -24.7561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7371 -23.9719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9247 -23.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3795 -24.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6329 -27.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0830 -28.1061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2759 -27.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7262 -28.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9836 -29.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7958 -29.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3419 -28.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2835 -23.3509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1043 -23.4320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.4352 -22.6765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8188 -22.1282 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1070 -22.5451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2410 -22.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 1 0
10 15 1 0
11 12 1 0
13 14 1 0
14 15 1 0
7 10 1 0
15 16 1 0
13 17 1 0
12 18 1 0
11 19 2 0
14 20 2 0
16 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 16 1 0
18 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 33 1 0
23 33 1 0
35 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.01Molecular Weight (Monoisotopic): 527.1724AlogP: 5.20#Rotatable Bonds: 9Polar Surface Area: 104.12Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.09CX LogD: 5.09Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -1.32
References 1. Xu C, Xiao Z, Wang J, Lai H, Zhang T, Guan Z, Xia M, Chen M, Ren L, He Y, Gao Y, Zhao C.. (2021) Discovery of a Potent Glutathione Peroxidase 4 Inhibitor as a Selective Ferroptosis Inducer., 64 (18.0): [PMID:34506134 ] [10.1021/acs.jmedchem.1c00569 ]