NA

ID: ALA4875422

PubChem CID: 156295589

Max Phase: Preclinical

Molecular Formula: C32H31ClF2N6O4

Molecular Weight: 637.09

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(=O)N1C[C@H](C)N(c2nc(=O)n3c4nc(c(Cl)cc24)-c2c(F)ccc(F)c2OCCOc2ccnc(C(C)C)c2-3)C[C@H]1C

Standard InChI:  InChI=1S/C32H31ClF2N6O4/c1-6-24(42)39-14-18(5)40(15-17(39)4)30-19-13-20(33)27-25-21(34)7-8-22(35)29(25)45-12-11-44-23-9-10-36-26(16(2)3)28(23)41(31(19)37-27)32(43)38-30/h6-10,13,16-18H,1,11-12,14-15H2,2-5H3/t17-,18+/m1/s1

Standard InChI Key:  BBIVCWWQPMOKAC-MSOLQXFVSA-N

Molfile:  

 
     RDKit          2D

 45 50  0  0  0  0  0  0  0  0999 V2000
   32.3272   -5.7905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3260   -6.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0176   -6.9942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0158   -5.3899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7120   -5.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7128   -6.5894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4089   -6.9882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1048   -6.5856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1001   -5.7800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4033   -5.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6364   -6.9936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9411   -6.5909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2501   -6.9900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2490   -7.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9448   -8.1923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6371   -7.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9426   -5.7903    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.6359   -5.3903    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   32.3291   -8.1898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.7976   -6.9832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3990   -4.5842    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0965   -4.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0942   -3.3861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3985   -2.9857    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7035   -3.3886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7042   -4.1919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0149   -4.5954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3972   -2.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0919   -1.7836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0907   -0.9829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7054   -1.7858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4046   -7.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7055   -8.1824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7049   -8.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3938   -9.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0930   -8.9855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0942   -8.1877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7862   -7.7889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4807   -8.1907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3526   -7.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3245   -9.0139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0381   -9.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9471   -9.0178    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.8052   -2.9721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9916   -7.7661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  2 11  1  0
 12 17  1  0
  1 18  1  0
 16 19  1  0
  8 20  2  0
 10 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  1
 24 28  1  0
 28 29  1  0
 29 30  2  0
 28 31  2  0
  7 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 37 38  1  0
 38 39  1  0
 38 40  1  0
 19 41  1  0
 41 42  1  0
 15 43  1  0
 23 44  1  6
 33 45  1  0
 45 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875422

    ---

Associated Targets(Human)

KRAS Tclin GTPase KRas (1864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 637.09Molecular Weight (Monoisotopic): 636.2063AlogP: 5.28#Rotatable Bonds: 3
Polar Surface Area: 102.68Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.35CX LogP: 5.06CX LogD: 5.06
Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.28Np Likeness Score: -0.55

References

1. Kargbo RB..  (2021)  Small Molecule Inhibitors of KRAS G12C Mutant.,  12  (8.0): [PMID:34413946] [10.1021/acsmedchemlett.1c00389]

Source