(S)-N-(1-(4-methoxyphenyl)ethyl)-6-(1-methyl-1H-pyrazol-4-yl)imidazo[1,2-a]pyridine-3-carboxamide

ID: ALA4875425

PubChem CID: 164627211

Max Phase: Preclinical

Molecular Formula: C21H21N5O2

Molecular Weight: 375.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc([C@H](C)NC(=O)c2cnc3ccc(-c4cnn(C)c4)cn23)cc1

Standard InChI:  InChI=1S/C21H21N5O2/c1-14(15-4-7-18(28-3)8-5-15)24-21(27)19-11-22-20-9-6-16(13-26(19)20)17-10-23-25(2)12-17/h4-14H,1-3H3,(H,24,27)/t14-/m0/s1

Standard InChI Key:  XFBQGNNACTXBPY-AWEZNQCLSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   24.1237   -4.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1237   -5.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8289   -5.9267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8289   -4.2923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5342   -4.7050    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.5342   -5.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3080   -5.7702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7864   -5.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3081   -4.4537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4171   -4.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3293   -3.4869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5295   -3.3194    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.1229   -4.0283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6716   -4.6339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3105   -4.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5606   -3.6765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3600   -3.5066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0138   -3.0692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6125   -2.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4119   -2.5596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0657   -2.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9568   -3.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7555   -2.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0088   -2.2217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4572   -1.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6606   -1.7856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8079   -2.0508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.3555   -2.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 10  2  0
  1 10  1  0
 13 15  1  0
  9 16  1  0
 16 17  1  0
 16 18  2  0
 19 17  1  1
 19 20  1  0
 19 21  1  0
 20 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 20  1  0
 24 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875425

    ---

Associated Targets(Human)

CLK1 Tchem Dual specificty protein kinase CLK1 (2189 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 375.43Molecular Weight (Monoisotopic): 375.1695AlogP: 3.23#Rotatable Bonds: 5
Polar Surface Area: 73.45Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.48CX LogP: 1.81CX LogD: 1.81
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.58Np Likeness Score: -1.71

References

1. Zhang Y, Xia A, Zhang S, Lin G, Liu J, Chen P, Mu B, Jiao Y, Xu W, Chen M, Li L..  (2021)  Discovery of 3,6-disubstutited-imidazo[1,2-a]pyridine derivatives as a new class of CLK1 inhibitors.,  41  [PMID:33662541] [10.1016/j.bmcl.2021.127881]

Source