The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4875436
PubChem CID: 164627405
Max Phase: Preclinical
Molecular Formula: C27H46O3
Molecular Weight: 418.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(O)(CCCCCCO)C1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
Standard InChI: InChI=1S/C27H46O3/c1-25-15-12-20(29)18-19(25)8-9-21-22-10-11-24(26(22,2)16-13-23(21)25)27(3,30)14-6-4-5-7-17-28/h8,20-24,28-30H,4-7,9-18H2,1-3H3/t20-,21-,22-,23-,24?,25-,26-,27?/m0/s1
Standard InChI Key: TZQMDXPSIZYUCJ-HKIFLSDQSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
17.0630 -13.9600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4588 -13.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4588 -12.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6974 -12.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9360 -12.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9360 -13.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6974 -14.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4297 -13.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1787 -12.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1787 -11.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9359 -10.9769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6974 -11.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1787 -10.8273 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.4173 -10.9769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6558 -11.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6558 -12.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4173 -12.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0159 -11.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0096 -10.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3658 -10.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2363 -10.1210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1520 -11.0165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9357 -11.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4642 -11.1645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5598 -10.3639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7044 -10.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1122 -9.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2568 -10.0846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6645 -9.4361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8092 -9.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3374 -9.1006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8920 -10.6307 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.1787 -12.8762 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
4 3 1 0
5 4 1 0
6 5 1 0
7 6 1 0
2 7 1 0
5 8 1 1
9 5 1 0
10 9 1 0
11 10 1 0
12 11 1 0
4 12 2 0
10 13 1 1
14 10 1 0
15 14 1 0
16 15 1 0
17 16 1 0
9 17 1 0
15 18 1 1
19 15 1 0
20 19 1 0
21 20 1 0
14 21 1 0
19 22 1 0
22 23 1 0
22 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
14 32 1 6
9 33 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.66Molecular Weight (Monoisotopic): 418.3447AlogP: 5.62#Rotatable Bonds: 7Polar Surface Area: 60.69Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.52CX LogD: 4.52Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.37Np Likeness Score: 2.67
References 1. Zhao F, Wu Y, Zhou F, Xue D, Zhao S, Lu W, Liu X, Hu T, Qiu Y, Li R, Gu T, Xu Y, Xu F, Zhong G, Jiang Z, Zhao S, Tao H.. (2021) Elucidation of Distinct Modular Assemblies of Smoothened Receptor by Bitopic Ligand Measurement., 64 (18.0): [PMID:34492176 ] [10.1021/acs.jmedchem.1c01220 ]