The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(((4'-(5-(acetamidomethyl)-2-oxooxazolidin-3-yl)-2'-fluorobiphenyl-4-yl)methoxy)carbonyl)phenylboronic acid ID: ALA4875440
PubChem CID: 164627408
Max Phase: Preclinical
Molecular Formula: C26H24BFN2O7
Molecular Weight: 506.30
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)NCC1CN(c2ccc(-c3ccc(COC(=O)c4ccc(B(O)O)cc4)cc3)c(F)c2)C(=O)O1
Standard InChI: InChI=1S/C26H24BFN2O7/c1-16(31)29-13-22-14-30(26(33)37-22)21-10-11-23(24(28)12-21)18-4-2-17(3-5-18)15-36-25(32)19-6-8-20(9-7-19)27(34)35/h2-12,22,34-35H,13-15H2,1H3,(H,29,31)
Standard InChI Key: SZYVYDVUVLHIJX-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
28.6641 -5.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0663 -6.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8840 -6.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3003 -5.7203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8931 -5.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0768 -5.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1132 -5.7265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5158 -6.4390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3322 -6.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7470 -5.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3394 -5.0272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5243 -5.0242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0975 -7.1417 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.5653 -5.7467 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0371 -6.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8173 -6.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8236 -5.3463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0473 -5.0877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7954 -4.3073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4747 -6.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2238 -6.3234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.8812 -6.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6303 -6.4821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7896 -7.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8469 -5.6970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4447 -4.9857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6275 -4.9784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2252 -4.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2126 -5.6824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6419 -3.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2404 -2.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4223 -2.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0076 -3.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4115 -4.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0189 -2.1337 0.0000 B 0 0 0 0 0 0 0 0 0 0 0 0
25.4344 -1.4300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2017 -2.1257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
4 7 1 0
8 13 1 0
10 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
18 19 2 0
16 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
1 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 28 1 0
32 35 1 0
35 36 1 0
35 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.30Molecular Weight (Monoisotopic): 506.1661AlogP: ┄#Rotatable Bonds: ┄Polar Surface Area: ┄Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: ┄HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: ┄CX LogD: ┄Aromatic Rings: ┄Heavy Atoms: ┄QED Weighted: ┄Np Likeness Score: ┄
References 1. Cruz CD, Wrigstedt P, Moslova K, Iashin V, Mäkkylä H, Ghemtio L, Heikkinen S, Tammela P, Perea-Buceta JE.. (2021) Installation of an aryl boronic acid function into the external section of N-aryl-oxazolidinones: Synthesis and antimicrobial evaluation., 211 [PMID:33223262 ] [10.1016/j.ejmech.2020.113002 ]