5-(1H-indol-3-yl)-1-methyl-1H-benzo[d][1,2,3]triazol-4-amine

ID: ALA4875453

PubChem CID: 164627659

Max Phase: Preclinical

Molecular Formula: C15H13N5

Molecular Weight: 263.30

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1nnc2ccc(-c3c[nH]c4ccccc34)c(N)c21

Standard InChI:  InChI=1S/C15H13N5/c1-20-15-13(18-19-20)7-6-10(14(15)16)11-8-17-12-5-3-2-4-9(11)12/h2-8,17H,16H2,1H3

Standard InChI Key:  MSXKMWFQAJPRGJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 23  0  0  0  0  0  0  0  0999 V2000
   35.4969  -11.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4957  -11.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2038  -12.3513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2020  -10.7140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9106  -11.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9154  -11.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6954  -12.1863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.1728  -11.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6877  -10.8618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9356  -10.0831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7358   -9.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6313   -8.7085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3870   -9.4861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4358   -8.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9809   -9.1331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7255   -8.8019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.6405   -7.9913    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.8434   -7.8218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2855  -10.5180    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4331   -9.2106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 15  1  0
 14 12  1  0
 12 13  2  0
 13 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 11 19  1  0
 16 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875453

    ---

Associated Targets(Human)

TDO2 Tchem Tryptophan 2,3-dioxygenase (1554 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 263.30Molecular Weight (Monoisotopic): 263.1171AlogP: 2.70#Rotatable Bonds: 1
Polar Surface Area: 72.52Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.48CX LogP: 2.34CX LogD: 2.34
Aromatic Rings: 4Heavy Atoms: 20QED Weighted: 0.52Np Likeness Score: -0.78

References

1. Kozlova A, Thabault L, Liberelle M, Klaessens S, Prévost JRC, Mathieu C, Pilotte L, Stroobant V, Van den Eynde B, Frédérick R..  (2021)  Rational Design of Original Fused-Cycle Selective Inhibitors of Tryptophan 2,3-Dioxygenase.,  64  (15.0): [PMID:34338527] [10.1021/acs.jmedchem.1c00323]

Source