The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-2-(4-(((2-([1,1'-biphenyl]-4-ylmethylene)-3-oxo-2,3-dihydrobenzofuran-6-yl)oxy)methyl)-2,6-dimethylphenoxy)-2-methylpropanoic acid ID: ALA4875481
PubChem CID: 164627935
Max Phase: Preclinical
Molecular Formula: C34H30O6
Molecular Weight: 534.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(COc2ccc3c(c2)O/C(=C\c2ccc(-c4ccccc4)cc2)C3=O)cc(C)c1OC(C)(C)C(=O)O
Standard InChI: InChI=1S/C34H30O6/c1-21-16-24(17-22(2)32(21)40-34(3,4)33(36)37)20-38-27-14-15-28-29(19-27)39-30(31(28)35)18-23-10-12-26(13-11-23)25-8-6-5-7-9-25/h5-19H,20H2,1-4H3,(H,36,37)/b30-18-
Standard InChI Key: GXQBOOFNAQBFPW-YKQZZPSBSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
38.2491 -26.0724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9562 -25.6627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6645 -26.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6042 -25.5434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1997 -24.8377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7907 -25.5408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3716 -25.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0787 -26.0693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7852 -25.6603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7844 -24.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0711 -24.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3674 -24.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0669 -23.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4934 -26.0681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4909 -24.4316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.9063 -24.4275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6152 -24.8340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.9040 -23.6103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.5429 -25.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5505 -27.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2541 -26.8836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8372 -26.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8387 -26.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0620 -25.8165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.5804 -26.4767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0595 -27.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8056 -27.9154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7632 -26.4753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3559 -25.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7691 -25.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3625 -24.3532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5444 -24.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1347 -25.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5437 -25.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1362 -23.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5456 -22.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1380 -22.2305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3200 -22.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9112 -22.9421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3211 -23.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
5 4 1 0
6 5 1 0
3 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
11 13 1 0
9 14 1 0
10 15 1 0
15 5 1 0
5 16 1 0
16 17 1 0
16 18 2 0
1 19 2 0
19 23 1 0
22 20 1 0
20 21 2 0
21 1 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 1 0
26 22 1 0
26 27 2 0
25 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.61Molecular Weight (Monoisotopic): 534.2042AlogP: 7.41#Rotatable Bonds: 8Polar Surface Area: 82.06Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.71CX Basic pKa: ┄CX LogP: 7.76CX LogD: 4.46Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.24Np Likeness Score: -0.20
References 1. Liu K, Zhao X, Qi X, Hou DL, Li HB, Gu YH, Xu QL.. (2021) Design, synthesis, and biological evaluation of a novel dual peroxisome proliferator-activated receptor alpha/delta agonist for the treatment of diabetic kidney disease through anti-inflammatory mechanisms., 218 [PMID:33784603 ] [10.1016/j.ejmech.2021.113388 ]