N-((3,5-difluoropyridin-2-yl)methyl)-2-(3-fluoro-4-(5-azaspiro[2.5]octan-5-yl)piperidin-1-yl)thiazole-5-carboxamide

ID: ALA4875484

PubChem CID: 156735161

Max Phase: Preclinical

Molecular Formula: C22H26F3N5OS

Molecular Weight: 465.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NCc1ncc(F)cc1F)c1cnc(N2CCC(N3CCCC4(CC4)C3)C(F)C2)s1

Standard InChI:  InChI=1S/C22H26F3N5OS/c23-14-8-15(24)17(26-9-14)10-27-20(31)19-11-28-21(32-19)29-7-2-18(16(25)12-29)30-6-1-3-22(13-30)4-5-22/h8-9,11,16,18H,1-7,10,12-13H2,(H,27,31)

Standard InChI Key:  LKPAKMYDZQMMOO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   11.2632  -11.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2673  -12.4849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9730  -12.0727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3399  -13.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3388  -14.2206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0468  -14.6296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7565  -14.2201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7537  -13.3975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0450  -12.9922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0426  -12.1750    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.6308  -14.6286    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.4598  -12.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1691  -13.3921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8752  -12.9809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5845  -13.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8722  -12.1637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6708  -14.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4708  -14.3659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8767  -13.6566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3276  -13.0515    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.6891  -13.5681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1724  -14.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9814  -14.1451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3149  -13.3987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8331  -12.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0177  -12.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1276  -13.3132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6046  -13.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4140  -13.8964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7503  -13.1513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4553  -12.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1651  -11.9908    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
  5 11  1  0
  8 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 15  1  0
 19 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 27 31  1  0
 28 29  1  0
 29 30  1  0
 30  2  1  0
  2 31  1  0
 25 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875484

    ---

Associated Targets(Human)

ADRA2C Tclin Alpha-2c adrenergic receptor (4876 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 465.55Molecular Weight (Monoisotopic): 465.1810AlogP: 3.54#Rotatable Bonds: 5
Polar Surface Area: 61.36Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.71CX Basic pKa: 7.53CX LogP: 2.86CX LogD: 2.49
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.73Np Likeness Score: -1.14

References

1. Sabnis RW..  (2021)  Novel Substituted Heterocyclic Carboxamides as Adrenoreceptor ADRAC2 Inhibitors for Treating Diseases.,  12  (9.0): [PMID:34531943] [10.1021/acsmedchemlett.1c00423]

Source