The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((3,5-difluoropyridin-2-yl)methyl)-2-(3-fluoro-4-(5-azaspiro[2.5]octan-5-yl)piperidin-1-yl)thiazole-5-carboxamide ID: ALA4875484
PubChem CID: 156735161
Max Phase: Preclinical
Molecular Formula: C22H26F3N5OS
Molecular Weight: 465.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1ncc(F)cc1F)c1cnc(N2CCC(N3CCCC4(CC4)C3)C(F)C2)s1
Standard InChI: InChI=1S/C22H26F3N5OS/c23-14-8-15(24)17(26-9-14)10-27-20(31)19-11-28-21(32-19)29-7-2-18(16(25)12-29)30-6-1-3-22(13-30)4-5-22/h8-9,11,16,18H,1-7,10,12-13H2,(H,27,31)
Standard InChI Key: LKPAKMYDZQMMOO-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
11.2632 -11.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2673 -12.4849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9730 -12.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3399 -13.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3388 -14.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0468 -14.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7565 -14.2201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7537 -13.3975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0450 -12.9922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0426 -12.1750 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.6308 -14.6286 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.4598 -12.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1691 -13.3921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8752 -12.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5845 -13.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8722 -12.1637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6708 -14.1990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4708 -14.3659 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8767 -13.6566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3276 -13.0515 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.6891 -13.5681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1724 -14.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9814 -14.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3149 -13.3987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8331 -12.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0177 -12.8227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1276 -13.3132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6046 -13.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4140 -13.8964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7503 -13.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4553 -12.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1651 -11.9908 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
5 11 1 0
8 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 15 1 0
19 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
27 31 1 0
28 29 1 0
29 30 1 0
30 2 1 0
2 31 1 0
25 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.55Molecular Weight (Monoisotopic): 465.1810AlogP: 3.54#Rotatable Bonds: 5Polar Surface Area: 61.36Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.71CX Basic pKa: 7.53CX LogP: 2.86CX LogD: 2.49Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.73Np Likeness Score: -1.14