The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-(5-((2-chlorophenyl)amino)-1H-indazol-1-yl)-N-(1-(methyl-d3)pyrrolidin-3-yl)thiophene-2-carboxamide ID: ALA4875508
PubChem CID: 156155627
Max Phase: Preclinical
Molecular Formula: C23H22ClN5OS
Molecular Weight: 451.98
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: [2H]C([2H])([2H])N1CC[C@H](NC(=O)c2cc(-n3ncc4cc(Nc5ccccc5Cl)ccc43)cs2)C1
Standard InChI: InChI=1S/C23H22ClN5OS/c1-28-9-8-17(13-28)27-23(30)22-11-18(14-31-22)29-21-7-6-16(10-15(21)12-25-29)26-20-5-3-2-4-19(20)24/h2-7,10-12,14,17,26H,8-9,13H2,1H3,(H,27,30)/t17-/m0/s1/i1D3
Standard InChI Key: OTFWOWGRYVMGKI-DBHFXHLNSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
2.1957 -12.1382 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9056 -12.5468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9045 -11.7277 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7281 -15.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4358 -15.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0204 -15.2914 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7281 -16.5172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0204 -14.4742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1845 -15.6247 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.7313 -15.0174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3227 -14.3097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5234 -14.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6550 -13.5631 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7898 -12.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2432 -12.8596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5333 -12.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4493 -13.3991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1127 -13.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8604 -13.5419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9407 -12.7229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2764 -12.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6848 -12.3851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7643 -11.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5081 -11.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5879 -10.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9228 -9.9493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1760 -10.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0998 -11.1028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1715 -11.7154 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.6805 -13.9890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4280 -13.2118 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6108 -13.2118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3584 -13.9890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7211 -12.6360 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 6 1 0
4 7 2 0
8 6 1 1
5 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 5 2 0
11 13 1 0
13 17 1 0
16 14 1 0
14 15 2 0
15 13 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
20 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
24 29 1 0
8 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 8 1 0
31 2 1 0
2 34 1 0
M ISO 3 1 2 3 2 34 2
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.98Molecular Weight (Monoisotopic): 451.1234AlogP: 4.92#Rotatable Bonds: 5Polar Surface Area: 62.19Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.58CX LogP: 4.08CX LogD: 3.68Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.45Np Likeness Score: -1.94
References 1. Feng Y, Park H, Ryu JC, Yoon SO.. (2021) N -Aromatic-Substituted Indazole Derivatives as Brain-Penetrant and Orally Bioavailable JNK3 Inhibitors., 12 (10.0): [PMID:34676036 ] [10.1021/acsmedchemlett.1c00334 ]