The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 3-(2-(tert-butylamino)-1-(N-(4-chlorobenzyl)-6-(2-(2,6-dioxopiperidin-3-yl)-1-oxoisoindolin-4-yl)hex-5-ynamido)-2-oxoethyl)-6-chloro-1H-indole-2-carboxylate ID: ALA4875525
PubChem CID: 164628473
Max Phase: Preclinical
Molecular Formula: C43H43Cl2N5O7
Molecular Weight: 812.75
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1[nH]c2cc(Cl)ccc2c1C(C(=O)NC(C)(C)C)N(Cc1ccc(Cl)cc1)C(=O)CCCC#Cc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O
Standard InChI: InChI=1S/C43H43Cl2N5O7/c1-5-57-42(56)37-36(30-19-18-28(45)22-32(30)46-37)38(40(54)48-43(2,3)4)50(23-25-14-16-27(44)17-15-25)35(52)13-8-6-7-10-26-11-9-12-29-31(26)24-49(41(29)55)33-20-21-34(51)47-39(33)53/h9,11-12,14-19,22,33,38,46H,5-6,8,13,20-21,23-24H2,1-4H3,(H,48,54)(H,47,51,53)
Standard InChI Key: MCEPFWTVYSPNQF-UHFFFAOYSA-N
Molfile:
RDKit 2D
57 62 0 0 0 0 0 0 0 0999 V2000
34.9191 -14.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6219 -14.4164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3284 -14.8271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3224 -15.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0281 -16.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7380 -15.6474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0316 -14.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7356 -14.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3380 -14.2790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0062 -13.5378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1988 -13.6245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1376 -14.4473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.4133 -12.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2340 -12.8310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6410 -12.1265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2344 -11.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4162 -11.4170 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0047 -12.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6442 -10.7103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1875 -12.1262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6777 -13.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6777 -14.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3830 -15.2212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0882 -14.8168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0882 -13.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3830 -13.5868 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9706 -15.2264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3830 -16.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6753 -16.4470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0907 -16.4470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3752 -16.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3830 -12.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0907 -12.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7972 -12.7738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5044 -12.3659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5049 -11.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7922 -11.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0879 -11.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7972 -13.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9688 -13.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6770 -13.3228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2256 -13.9284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0835 -12.6139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8820 -12.7818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4247 -12.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1701 -11.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3678 -11.2353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8286 -11.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1096 -10.4600 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
29.0590 -14.7284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4415 -15.3925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2828 -14.9841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6733 -14.4398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8972 -14.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5037 -14.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2126 -13.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2120 -11.1383 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 3 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 8 1 0
7 3 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
9 12 2 0
10 13 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
16 19 2 0
18 20 2 0
21 22 1 0
21 26 1 0
22 23 1 0
24 25 2 0
25 26 1 0
22 27 2 0
23 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
26 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
25 39 1 0
21 40 1 0
40 44 1 0
43 41 1 0
41 42 1 0
42 40 2 0
43 44 2 0
44 45 1 0
45 46 2 0
46 47 1 0
47 48 2 0
48 43 1 0
47 49 1 0
42 50 1 0
50 51 2 0
50 52 1 0
52 53 1 0
53 54 1 0
39 55 1 0
55 56 1 0
56 1 1 0
36 57 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 812.75Molecular Weight (Monoisotopic): 811.2540AlogP: 6.62#Rotatable Bonds: 11Polar Surface Area: 157.98Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 3CX Acidic pKa: 10.31CX Basic pKa: ┄CX LogP: 5.96CX LogD: 5.96Aromatic Rings: 4Heavy Atoms: 57QED Weighted: 0.07Np Likeness Score: -0.73
References 1. Wang B, Liu J, Tandon I, Wu S, Teng P, Liao J, Tang W.. (2021) Development of MDM2 degraders based on ligands derived from Ugi reactions: Lessons and discoveries., 219 [PMID:33862513 ] [10.1016/j.ejmech.2021.113425 ]