The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Benzhydryl spiro[penicillanate-6,5'-(4-benzoyl-3-benzyloxycarbonyl-2-pyrazolinen)] ID: ALA4875541
PubChem CID: 164628852
Max Phase: Preclinical
Molecular Formula: C38H33N3O6S
Molecular Weight: 659.76
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)S[C@H]2N(C(=O)C23NN=C(C(=O)OCc2ccccc2)C3C(=O)c2ccccc2)[C@H]1C(=O)OC(c1ccccc1)c1ccccc1
Standard InChI: InChI=1S/C38H33N3O6S/c1-37(2)32(34(44)47-31(26-19-11-5-12-20-26)27-21-13-6-14-22-27)41-35(45)38(36(41)48-37)28(30(42)25-17-9-4-10-18-25)29(39-40-38)33(43)46-23-24-15-7-3-8-16-24/h3-22,28,31-32,36,40H,23H2,1-2H3/t28?,32-,36+,38?/m0/s1
Standard InChI Key: NWURDHALFZKKSG-XVOAWNTPSA-N
Molfile:
RDKit 2D
49 55 0 0 0 0 0 0 0 0999 V2000
26.6831 -14.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6789 -13.2244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8930 -12.9735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4113 -13.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8998 -14.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4956 -14.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7830 -14.4541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5001 -14.8627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6872 -14.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5122 -14.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5166 -14.8747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3027 -15.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2954 -13.7907 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.5038 -13.2207 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
28.5626 -15.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0145 -16.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3707 -16.0748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1038 -15.4581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5863 -13.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1702 -12.9352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1775 -14.3641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3526 -14.3683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3122 -14.8915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5161 -14.6750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9364 -13.6560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3465 -12.9411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9311 -12.2293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1052 -12.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6966 -12.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1144 -13.6636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6305 -16.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4386 -17.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0824 -17.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2774 -17.3063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7297 -17.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9894 -18.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8022 -18.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3464 -18.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6938 -17.8061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5010 -17.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0500 -17.3558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7862 -16.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9796 -16.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3081 -15.7165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5892 -16.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5847 -16.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2976 -17.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0166 -16.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0175 -16.1285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 1 0
7 6 1 0
7 8 1 0
1 9 1 0
9 11 1 0
10 1 1 0
10 11 1 0
11 12 1 0
12 7 1 0
7 13 1 0
13 10 1 0
10 14 1 6
12 15 1 6
15 16 2 0
15 17 1 0
9 18 2 0
4 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
5 23 1 0
23 24 2 0
22 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
17 31 1 0
31 32 1 0
31 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
32 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 32 1 0
23 44 1 0
44 45 2 0
45 46 1 0
46 47 2 0
47 48 1 0
48 49 2 0
49 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 659.76Molecular Weight (Monoisotopic): 659.2090AlogP: 5.32#Rotatable Bonds: 9Polar Surface Area: 114.37Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.57CX Basic pKa: ┄CX LogP: 7.32CX LogD: 7.32Aromatic Rings: 4Heavy Atoms: 48QED Weighted: 0.15Np Likeness Score: -0.09
References 1. Alves NG, Bártolo I, Alves AJS, Fontinha D, Francisco D, Lopes SMM, Soares MIL, Simões CJV, Prudêncio M, Taveira N, Pinho E Melo TMVD.. (2021) Synthesis and structure-activity relationships of new chiral spiro-β-lactams highly active against HIV-1 and Plasmodium., 219 [PMID:33887681 ] [10.1016/j.ejmech.2021.113439 ]