4-(2-(2,6-dichlorophenyl)-4-oxothiazolidin-3-yl)-N-(5-methylisoxazol-3-yl)benzenesulfonamide

ID: ALA4875558

PubChem CID: 164629088

Max Phase: Preclinical

Molecular Formula: C19H15Cl2N3O4S2

Molecular Weight: 484.39

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(NS(=O)(=O)c2ccc(N3C(=O)CSC3c3c(Cl)cccc3Cl)cc2)no1

Standard InChI:  InChI=1S/C19H15Cl2N3O4S2/c1-11-9-16(22-28-11)23-30(26,27)13-7-5-12(6-8-13)24-17(25)10-29-19(24)18-14(20)3-2-4-15(18)21/h2-9,19H,10H2,1H3,(H,22,23)

Standard InChI Key:  CRBQHYFDPGYKCP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   12.2504  -16.3338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0754  -16.3338    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.6628  -15.6193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6712  -20.9048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4962  -20.9048    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.7530  -20.1206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0837  -19.6339    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4186  -20.1206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5342  -19.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1465  -20.4201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9309  -20.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1041  -19.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4868  -18.8055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7048  -19.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0825  -18.8091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7980  -18.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7971  -17.5718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0814  -17.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3652  -17.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3697  -18.4005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7924  -15.9200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7900  -15.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4551  -14.6107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1979  -13.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3728  -13.8291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1202  -14.6145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6809  -13.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6339  -19.8661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2880  -18.3423    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.9730  -21.2266    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  6  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  7 15  1  0
 18  2  1  0
  2 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 22  2  0
 24 27  1  0
  8 28  2  0
 14 29  1  0
 10 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875558

    ---

Associated Targets(non-human)

Mycobacterium tuberculosis variant bovis (1746 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.39Molecular Weight (Monoisotopic): 482.9881AlogP: 4.87#Rotatable Bonds: 5
Polar Surface Area: 92.51Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 5.86CX Basic pKa: 0.38CX LogP: 4.03CX LogD: 3.18
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -1.87

References

1. Trotsko N..  (2021)  Antitubercular properties of thiazolidin-4-ones - A review.,  215  [PMID:33588179] [10.1016/j.ejmech.2021.113266]

Source