The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(2,6-dichlorophenyl)-4-oxothiazolidin-3-yl)-N-(5-methylisoxazol-3-yl)benzenesulfonamide ID: ALA4875558
PubChem CID: 164629088
Max Phase: Preclinical
Molecular Formula: C19H15Cl2N3O4S2
Molecular Weight: 484.39
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(NS(=O)(=O)c2ccc(N3C(=O)CSC3c3c(Cl)cccc3Cl)cc2)no1
Standard InChI: InChI=1S/C19H15Cl2N3O4S2/c1-11-9-16(22-28-11)23-30(26,27)13-7-5-12(6-8-13)24-17(25)10-29-19(24)18-14(20)3-2-4-15(18)21/h2-9,19H,10H2,1H3,(H,22,23)
Standard InChI Key: CRBQHYFDPGYKCP-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
12.2504 -16.3338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0754 -16.3338 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.6628 -15.6193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6712 -20.9048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4962 -20.9048 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.7530 -20.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0837 -19.6339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4186 -20.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5342 -19.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1465 -20.4201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9309 -20.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1041 -19.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4868 -18.8055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7048 -19.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0825 -18.8091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7980 -18.3961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7971 -17.5718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0814 -17.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3652 -17.5776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3697 -18.4005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7924 -15.9200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7900 -15.0949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4551 -14.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1979 -13.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3728 -13.8291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1202 -14.6145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6809 -13.1579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6339 -19.8661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2880 -18.3423 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.9730 -21.2266 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
6 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
7 15 1 0
18 2 1 0
2 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 22 2 0
24 27 1 0
8 28 2 0
14 29 1 0
10 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.39Molecular Weight (Monoisotopic): 482.9881AlogP: 4.87#Rotatable Bonds: 5Polar Surface Area: 92.51Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.86CX Basic pKa: 0.38CX LogP: 4.03CX LogD: 3.18Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -1.87