The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-bromo-4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[[1-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]cyclopropyl]methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-ol ID: ALA4875572
PubChem CID: 156405076
Max Phase: Preclinical
Molecular Formula: C32H38BrFN6O2
Molecular Weight: 637.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Oc1cc(N2CCc3c(nc(OCC4(CN5CC[C@@H](F)C5)CC4)nc3N3CC4CCC(C3)N4)C2)c2c(Br)cccc2c1
Standard InChI: InChI=1S/C32H38BrFN6O2/c33-26-3-1-2-20-12-24(41)13-28(29(20)26)39-11-7-25-27(17-39)36-31(37-30(25)40-15-22-4-5-23(16-40)35-22)42-19-32(8-9-32)18-38-10-6-21(34)14-38/h1-3,12-13,21-23,35,41H,4-11,14-19H2/t21-,22?,23?/m1/s1
Standard InChI Key: WVLFHNZKPFLBQZ-DDRJZQQSSA-N
Molfile:
RDKit 2D
42 49 0 0 0 0 0 0 0 0999 V2000
9.8847 -5.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4802 -6.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2973 -6.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6487 -6.0903 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3584 -5.6809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3555 -4.8582 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6469 -4.4530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9406 -5.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9448 -4.8618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2410 -4.4507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5286 -4.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5244 -5.6743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2327 -6.0899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6457 -3.6385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3536 -3.2284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3524 -2.4147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6449 -2.0051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9370 -2.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9365 -3.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8182 -6.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1127 -5.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4031 -6.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3977 -6.8855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8147 -6.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1093 -7.2944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1059 -8.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8071 -8.5134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5132 -8.1063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5132 -7.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0667 -6.0884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6980 -5.6543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2213 -6.8896 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
6.1867 -3.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0204 -3.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7738 -5.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4834 -6.9034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7763 -7.3131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0295 -6.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4836 -7.5946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8934 -8.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6924 -8.1304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5622 -9.0488 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
7 14 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 25 1 0
24 20 1 0
12 20 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 24 2 0
5 30 1 0
22 31 1 0
29 32 1 0
18 33 1 0
33 34 1 0
34 16 1 0
30 35 1 0
35 2 1 0
2 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 37 1 0
40 42 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 637.60Molecular Weight (Monoisotopic): 636.2224AlogP: 4.80#Rotatable Bonds: 7Polar Surface Area: 76.99Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.32CX Basic pKa: 9.95CX LogP: 4.66CX LogD: 2.83Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.38Np Likeness Score: -0.17