The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-chloro-6-methylphenyl)-2-((6-(4-(2-((2-(2,6-dioxopiperidin-3-yl)-1-oxoisoindolin-4-yl)thio)acetyl)piperazin-1-yl)-2-methylpyrimidin-4-yl)amino)thiazole-5-carboxamide ID: ALA4875587
PubChem CID: 153351687
Max Phase: Preclinical
Molecular Formula: C35H34ClN9O5S2
Molecular Weight: 760.30
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)cc(N2CCN(C(=O)CSc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)CC2)n1
Standard InChI: InChI=1S/C35H34ClN9O5S2/c1-19-5-3-7-23(36)31(19)42-33(49)26-16-37-35(52-26)40-27-15-28(39-20(2)38-27)43-11-13-44(14-12-43)30(47)18-51-25-8-4-6-21-22(25)17-45(34(21)50)24-9-10-29(46)41-32(24)48/h3-8,15-16,24H,9-14,17-18H2,1-2H3,(H,42,49)(H,41,46,48)(H,37,38,39,40)
Standard InChI Key: YPUFMWKOTXCGRO-UHFFFAOYSA-N
Molfile:
RDKit 2D
52 58 0 0 0 0 0 0 0 0999 V2000
33.4144 -19.7570 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.4144 -18.9437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6783 -18.5536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6783 -17.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3848 -17.3045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1045 -17.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1045 -18.5219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8961 -18.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3649 -18.0943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8782 -17.4393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1200 -16.6546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1859 -18.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6071 -18.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4248 -18.7962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8275 -18.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4104 -17.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5865 -17.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6487 -18.0713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2024 -19.5126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7095 -20.1372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0213 -19.6964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2956 -20.0720 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.6008 -19.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8415 -20.0052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8415 -20.8302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.1107 -21.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4192 -20.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6912 -21.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0031 -20.6917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.2736 -21.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5391 -20.6987 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.9625 -21.2815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1512 -21.1574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6348 -21.7954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8235 -21.6713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5248 -20.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7132 -20.7738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2006 -21.4181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5018 -22.1847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3113 -22.3069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6083 -23.0726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0382 -20.2573 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
23.8547 -20.3914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3336 -22.0105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1442 -21.8791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6912 -21.9530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3323 -22.4016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1107 -22.0275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3323 -23.2215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5236 -21.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2956 -20.8946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0213 -18.8801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
6 7 1 0
2 7 2 0
7 8 1 0
8 9 1 0
9 10 1 0
10 6 1 0
10 11 2 0
9 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
12 17 1 0
15 18 2 0
13 19 2 0
20 1 1 0
21 20 1 0
22 21 1 0
23 22 1 0
24 23 1 0
25 24 1 0
26 25 1 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 1 0
31 30 1 0
32 31 1 0
33 32 1 0
34 33 1 0
35 34 1 0
36 35 1 0
37 36 2 0
38 37 1 0
39 38 2 0
40 39 1 0
35 40 2 0
40 41 1 0
36 42 1 0
33 43 2 0
44 32 2 0
45 44 1 0
30 45 2 0
46 28 1 0
47 46 2 0
48 47 1 0
26 48 2 0
47 49 1 0
25 50 1 0
51 50 1 0
22 51 1 0
21 52 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 760.30Molecular Weight (Monoisotopic): 759.1813AlogP: 4.40#Rotatable Bonds: 9Polar Surface Area: 169.83Molecular Species: BASEHBA: 12HBD: 3#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.49CX Basic pKa: 10.11CX LogP: 4.12CX LogD: 4.04Aromatic Rings: 4Heavy Atoms: 52QED Weighted: 0.16Np Likeness Score: -1.66
References 1. Liu H, Ding X, Liu L, Mi Q, Zhao Q, Shao Y, Ren C, Chen J, Kong Y, Qiu X, Elvassore N, Yang X, Yin Q, Jiang B.. (2021) Discovery of novel BCR-ABL PROTACs based on the cereblon E3 ligase design, synthesis, and biological evaluation., 223 [PMID:34217059 ] [10.1016/j.ejmech.2021.113645 ]