(S)-N-((2S,3R)-3-hydroxy-4-(N-isobutyl-4-methoxyphenylsulfonamido)-1-phenylbutan-2-yl)piperidine-3-carboxamide

ID: ALA4875597

PubChem CID: 164626152

Max Phase: Preclinical

Molecular Formula: C27H39N3O5S

Molecular Weight: 517.69

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)[C@H]2CCCNC2)cc1

Standard InChI:  InChI=1S/C27H39N3O5S/c1-20(2)18-30(36(33,34)24-13-11-23(35-3)12-14-24)19-26(31)25(16-21-8-5-4-6-9-21)29-27(32)22-10-7-15-28-17-22/h4-6,8-9,11-14,20,22,25-26,28,31H,7,10,15-19H2,1-3H3,(H,29,32)/t22-,25-,26+/m0/s1

Standard InChI Key:  WZCSZCGNEYLDGF-UCGXPXSYSA-N

Molfile:  

 
     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
    7.1814   -9.1624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5941   -9.8723    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.0025   -9.1600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1969  -10.2685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1969  -11.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9063  -11.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6157  -11.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6157  -10.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9063   -9.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3287   -9.8620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3311   -9.0407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0352  -10.2727    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7483   -9.8662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4589  -10.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7507   -9.0449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4637   -8.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1742   -9.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8868   -8.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8896   -7.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1740   -7.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4643   -7.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4565  -11.0982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1719   -9.8703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8826  -10.2810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8802  -11.1023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3062  -10.2851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2988  -11.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0086  -11.5221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7185  -11.1114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7183  -10.2859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0120   -9.8790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4674  -11.8080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6502  -11.8033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8719  -12.5180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4265  -11.5196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4269  -12.3368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  1
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  1
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 14 22  1  1
 14 23  1  0
 23 24  1  0
 24 25  1  0
 24  2  1  0
  2 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 25 32  1  0
 32 33  1  0
 32 34  1  0
 29 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875597

    ---

Associated Targets(Human)

HEK-293T (167025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 protease (9113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 517.69Molecular Weight (Monoisotopic): 517.2610AlogP: 2.43#Rotatable Bonds: 12
Polar Surface Area: 107.97Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.76CX Basic pKa: 9.60CX LogP: 2.84CX LogD: 0.67
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -0.59

References

1. Zhu M, Zhou H, Ma L, Dong B, Zhou J, Zhang G, Wang M, Wang J, Cen S, Wang Y..  (2021)  Design and evaluation of novel piperidine HIV-1 protease inhibitors with potency against DRV-resistant variants.,  220  [PMID:33906049] [10.1016/j.ejmech.2021.113450]

Source