The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((2S,3R)-3-hydroxy-4-(N-isobutyl-4-methoxyphenylsulfonamido)-1-phenylbutan-2-yl)piperidine-3-carboxamide ID: ALA4875597
PubChem CID: 164626152
Max Phase: Preclinical
Molecular Formula: C27H39N3O5S
Molecular Weight: 517.69
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)[C@H]2CCCNC2)cc1
Standard InChI: InChI=1S/C27H39N3O5S/c1-20(2)18-30(36(33,34)24-13-11-23(35-3)12-14-24)19-26(31)25(16-21-8-5-4-6-9-21)29-27(32)22-10-7-15-28-17-22/h4-6,8-9,11-14,20,22,25-26,28,31H,7,10,15-19H2,1-3H3,(H,29,32)/t22-,25-,26+/m0/s1
Standard InChI Key: WZCSZCGNEYLDGF-UCGXPXSYSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
7.1814 -9.1624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5941 -9.8723 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.0025 -9.1600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1969 -10.2685 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1969 -11.0899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9063 -11.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6157 -11.0899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6157 -10.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9063 -9.8558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3287 -9.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3311 -9.0407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0352 -10.2727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7483 -9.8662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4589 -10.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7507 -9.0449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4637 -8.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1742 -9.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8868 -8.6413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8896 -7.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1740 -7.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4643 -7.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4565 -11.0982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1719 -9.8703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8826 -10.2810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8802 -11.1023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3062 -10.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2988 -11.1074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0086 -11.5221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7185 -11.1114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7183 -10.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0120 -9.8790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4674 -11.8080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6502 -11.8033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8719 -12.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4265 -11.5196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4269 -12.3368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 1
10 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
13 15 1 1
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
14 22 1 1
14 23 1 0
23 24 1 0
24 25 1 0
24 2 1 0
2 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
25 32 1 0
32 33 1 0
32 34 1 0
29 35 1 0
35 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 517.69Molecular Weight (Monoisotopic): 517.2610AlogP: 2.43#Rotatable Bonds: 12Polar Surface Area: 107.97Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.76CX Basic pKa: 9.60CX LogP: 2.84CX LogD: 0.67Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -0.59
References 1. Zhu M, Zhou H, Ma L, Dong B, Zhou J, Zhang G, Wang M, Wang J, Cen S, Wang Y.. (2021) Design and evaluation of novel piperidine HIV-1 protease inhibitors with potency against DRV-resistant variants., 220 [PMID:33906049 ] [10.1016/j.ejmech.2021.113450 ]