The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3,5-bis(trifluoromethyl)phenyl)-3-(4-methoxyphenyl)-1H-pyrazolo[3,4-b]pyridin-5-amine ID: ALA4875657
PubChem CID: 164627223
Max Phase: Preclinical
Molecular Formula: C21H14F6N4O
Molecular Weight: 452.36
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2n[nH]c3ncc(Nc4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc23)cc1
Standard InChI: InChI=1S/C21H14F6N4O/c1-32-16-4-2-11(3-5-16)18-17-9-15(10-28-19(17)31-30-18)29-14-7-12(20(22,23)24)6-13(8-14)21(25,26)27/h2-10,29H,1H3,(H,28,30,31)
Standard InChI Key: ZMJQNEYGXPJOBO-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
41.7703 -4.1024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7691 -4.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4772 -5.3309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.4754 -3.6936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1840 -4.0988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1842 -4.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9672 -5.1762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.4509 -4.5100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.9668 -3.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2189 -3.0685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0195 -2.8994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2719 -2.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7246 -1.5149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9218 -1.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6731 -2.4647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0625 -3.6940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.3548 -4.1028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9759 -0.7373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.7749 -0.5660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6472 -3.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9400 -4.1007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9398 -4.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6526 -5.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3568 -4.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6556 -6.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9495 -6.5555 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.3649 -6.5501 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.6503 -6.9585 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.2324 -3.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2326 -2.8747 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.5246 -4.1003 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.5206 -3.2811 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 10 1 0
1 16 1 0
16 17 1 0
13 18 1 0
18 19 1 0
17 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 17 1 0
23 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
21 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.36Molecular Weight (Monoisotopic): 452.1072AlogP: 6.41#Rotatable Bonds: 4Polar Surface Area: 62.83Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.52CX Basic pKa: 1.84CX LogP: 5.52CX LogD: 5.52Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.35Np Likeness Score: -1.26
References 1. Park A, Hwang J, Lee JY, Heo EJ, Na YJ, Kang S, Jeong KS, Kim KY, Shin SJ, Lee H.. (2021) Synthesis of novel 1H-Pyrazolo[3,4-b]pyridine derivatives as DYRK 1A/1B inhibitors., 47 [PMID:34182093 ] [10.1016/j.bmcl.2021.128226 ]