2-(7-(4-(1-(6,7,10-trioxaspiro[4.5]decan-8-yl)vinyl)phenoxy)naphthalen-2-yloxy)ethanol

ID: ALA4875685

PubChem CID: 44224267

Max Phase: Preclinical

Molecular Formula: C27H28O6

Molecular Weight: 448.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(c1ccc(Oc2ccc3ccc(OCCO)cc3c2)cc1)C1COC2(CCCC2)OO1

Standard InChI:  InChI=1S/C27H28O6/c1-19(26-18-30-27(33-32-26)12-2-3-13-27)20-4-8-23(9-5-20)31-25-11-7-21-6-10-24(29-15-14-28)16-22(21)17-25/h4-11,16-17,26,28H,1-3,12-15,18H2

Standard InChI Key:  WREBNWVCHKDMAF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   11.5482   -1.5076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3365   -1.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7803   -1.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2663   -0.3997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5049   -0.6929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0651   -1.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0640   -2.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7720   -2.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7702   -1.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4788   -1.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4796   -2.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1881   -2.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8964   -2.3635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8917   -1.5413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1826   -1.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3573   -1.1434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6497   -1.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9419   -1.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2343   -1.5525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5969   -1.1284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3071   -1.5327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3074   -2.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0168   -2.7537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7230   -2.3407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7153   -1.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0054   -1.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4337   -2.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4397   -3.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1383   -2.3302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8455   -2.7362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5481   -2.3258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8357   -1.1028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1270   -1.5148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8 11  2  0
 10  9  2  0
  9  6  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  6 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 14 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  1  0
 29 33  1  0
 30 31  1  0
 31  1  1  0
  1 32  1  0
 32 33  1  0
M  END

Associated Targets(non-human)

Plasmodium yoelii (6656 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.52Molecular Weight (Monoisotopic): 448.1886AlogP: 5.63#Rotatable Bonds: 7
Polar Surface Area: 66.38Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.44CX LogD: 5.44
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: 0.41

References

1. Shukla M, Hassam M, Kumar Yadav D, Sharma S, Singh C, Puri SK, Shrivastava R, Prakash Verma V..  (2021)  Synthesis of novel 1,2,4-trioxanes and antimalarial evaluation against multidrug-resistant Plasmodium yoelii nigeriensis.,  49  [PMID:34365007] [10.1016/j.bmcl.2021.128305]

Source