The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(6-(4-(4-Methylpiperazin-1-yl)phenyl)thieno[2,3-d]-pyrimidin-4-yl)-N-(4-(trifluoromethoxy)phenyl)piperazine-1-carboxamide ID: ALA4875689
PubChem CID: 164627671
Max Phase: Preclinical
Molecular Formula: C29H30F3N7O2S
Molecular Weight: 597.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(c2ccc(-c3cc4c(N5CCN(C(=O)Nc6ccc(OC(F)(F)F)cc6)CC5)ncnc4s3)cc2)CC1
Standard InChI: InChI=1S/C29H30F3N7O2S/c1-36-10-12-37(13-11-36)22-6-2-20(3-7-22)25-18-24-26(33-19-34-27(24)42-25)38-14-16-39(17-15-38)28(40)35-21-4-8-23(9-5-21)41-29(30,31)32/h2-9,18-19H,10-17H2,1H3,(H,35,40)
Standard InChI Key: LZUHVNXINFPCGT-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
6.5871 -30.6488 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.7699 -30.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1785 -31.3565 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.2328 -29.4354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5271 -29.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5271 -30.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2365 -31.0780 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9459 -30.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9459 -29.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2365 -31.8985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5226 -32.3065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5226 -33.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2346 -33.5406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9456 -33.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9456 -32.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7211 -32.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2037 -32.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7305 -33.3670 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.0219 -32.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4391 -33.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2596 -33.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6639 -32.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2459 -31.9803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4267 -31.9803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4811 -32.6832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8911 -33.3864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7047 -33.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1099 -32.6701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6954 -31.9647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8756 -31.9694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9271 -32.6649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2310 -28.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9378 -28.2080 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5224 -28.2112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6464 -28.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6434 -29.4323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3512 -29.8393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0590 -29.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0545 -28.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3462 -28.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7681 -29.8351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0648 -31.0634 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 4 1 0
7 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
15 14 2 0
15 10 1 0
16 15 1 0
17 16 2 0
18 17 1 0
14 18 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
28 31 1 0
4 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
38 41 1 0
41 2 1 0
2 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.67Molecular Weight (Monoisotopic): 597.2134AlogP: 5.36#Rotatable Bonds: 5Polar Surface Area: 77.07Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.73CX Basic pKa: 7.84CX LogP: 6.01CX LogD: 5.43Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.33Np Likeness Score: -1.86
References 1. Li Y, Yang G, Zhang J, Tang P, Yang C, Wang G, Chen J, Liu J, Zhang L, Ouyang L.. (2021) Discovery, Synthesis, and Evaluation of Highly Selective Vascular Endothelial Growth Factor Receptor 3 (VEGFR3) Inhibitor for the Potential Treatment of Metastatic Triple-Negative Breast Cancer., 64 (16.0): [PMID:34351741 ] [10.1021/acs.jmedchem.1c00678 ]