[4-(1,1-Dioxo-1lambda*6*-isothiazolidin-2-yl)-phenyl]-[2-(1-methyl-piperidine-4-sulfonyl)-[1,6]naphthyridin-7-yl]-amine

ID: ALA4875691

PubChem CID: 164627945

Max Phase: Preclinical

Molecular Formula: C23H27N5O4S2

Molecular Weight: 501.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCC(S(=O)(=O)c2ccc3cnc(Nc4ccc(N5CCCS5(=O)=O)cc4)cc3n2)CC1

Standard InChI:  InChI=1S/C23H27N5O4S2/c1-27-12-9-20(10-13-27)34(31,32)23-8-3-17-16-24-22(15-21(17)26-23)25-18-4-6-19(7-5-18)28-11-2-14-33(28,29)30/h3-8,15-16,20H,2,9-14H2,1H3,(H,24,25)

Standard InChI Key:  QEOBTNYJSQKYHH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    9.6577  -10.8051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0704  -11.5150    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.4789  -10.8026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7063  -14.1770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9180  -13.9665    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.1298  -14.7545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6587  -13.1603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3683  -12.7508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3655  -11.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6569  -11.5229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9506  -12.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9529  -11.9336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2470  -11.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5383  -11.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5399  -12.7529    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2465  -13.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8305  -11.5236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1228  -11.9323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4164  -11.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7093  -11.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7090  -12.7464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4217  -13.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1259  -12.7444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7809  -11.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0040  -13.1552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2575  -12.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7133  -13.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1221  -14.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7814  -12.7373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4866  -13.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1951  -12.7353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1940  -11.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4843  -11.5068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9028  -13.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
 11  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 12  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 11  2  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  9  2  1  0
  2 24  1  0
 21 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28  5  1  0
  5 25  1  0
 24 29  1  0
 24 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875691

    ---

Associated Targets(Human)

CDK5 Tchem Cyclin-dependent kinase 5/CDK5 activator 1 (3697 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 501.63Molecular Weight (Monoisotopic): 501.1504AlogP: 2.78#Rotatable Bonds: 5
Polar Surface Area: 112.57Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.42CX LogP: 1.35CX LogD: 1.31
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.57Np Likeness Score: -1.64

References

1. Sabnis RW..  (2021)  Novel Substituted 1,6-Naphthyridines as CDK 5 Inhibitors for Treating Kidney Diseases.,  12  (9.0): [PMID:34531944] [10.1021/acsmedchemlett.1c00424]

Source