The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-(2-(hexahydro-1H-pyrrolizin-7a-yl)ethylimino)-N,5-diphenyl-3,5-dihydrophenazin-2-amine ID: ALA4875693
Max Phase: Preclinical
Molecular Formula: C33H33N5
Molecular Weight: 499.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(Nc2cc3nc4ccccc4n(-c4ccccc4)c-3c/c2=N\CCC23CCCN2CCC3)cc1
Standard InChI: InChI=1S/C33H33N5/c1-3-11-25(12-4-1)35-29-23-30-32(24-28(29)34-20-19-33-17-9-21-37(33)22-10-18-33)38(26-13-5-2-6-14-26)31-16-8-7-15-27(31)36-30/h1-8,11-16,23-24,35H,9-10,17-22H2/b34-28+
Standard InChI Key: LFEVQCYKCTUSAK-CDSHQWRTSA-N
Molfile:
RDKit 2D
38 44 0 0 0 0 0 0 0 0999 V2000
0.4277 -14.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4265 -15.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1414 -15.4312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1395 -13.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8549 -14.1874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8537 -15.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5705 -15.4357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5729 -13.7697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2931 -15.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5717 -12.9496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2879 -12.5378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2883 -11.7136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5733 -11.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8565 -11.7171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8596 -12.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0125 -15.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7329 -15.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7371 -14.1893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0145 -13.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2879 -14.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4459 -15.4392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4429 -16.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7259 -16.6697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7226 -17.4940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4361 -17.9098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1544 -17.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1542 -16.6726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4530 -13.7795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4560 -12.9545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1720 -12.5446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3847 -10.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9031 -11.3097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3914 -11.9747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1706 -10.8908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1789 -11.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9659 -11.9627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4442 -11.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9525 -10.6282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 9 2 0
20 8 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
9 16 1 0
9 20 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 2 0
17 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
18 28 2 0
28 29 1 0
29 30 1 0
34 31 1 0
31 32 1 0
32 33 1 0
33 35 1 0
35 30 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.66Molecular Weight (Monoisotopic): 499.2736AlogP: 6.79#Rotatable Bonds: 6Polar Surface Area: 45.45Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.55CX LogP: 6.20CX LogD: 3.15Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -0.65
References 1. Koval A, Bassanini I, Xu J, Tonelli M, Boido V, Sparatore F, Amant F, Annibali D, Leucci E, Sparatore A, Katanaev VL.. (2021) Optimization of the clofazimine structure leads to a highly water-soluble C3-aminopyridinyl riminophenazine endowed with improved anti-Wnt and anti-cancer activity in vitro and in vivo., 222 [PMID:34116325 ] [10.1016/j.ejmech.2021.113562 ]