The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1R,2S)-N-((1-(3,5-bis(trifluoromethyl)phenyl)-1H-1,2,3-triazol-4-yl)methyl)-2-(3,4-difluorophenyl)cyclopropanamine ID: ALA4875756
PubChem CID: 164629095
Max Phase: Preclinical
Molecular Formula: C20H14F8N4
Molecular Weight: 462.34
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Fc1ccc([C@@H]2C[C@H]2NCc2cn(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)nn2)cc1F
Standard InChI: InChI=1S/C20H14F8N4/c21-16-2-1-10(3-17(16)22)15-7-18(15)29-8-13-9-32(31-30-13)14-5-11(19(23,24)25)4-12(6-14)20(26,27)28/h1-6,9,15,18,29H,7-8H2/t15-,18+/m0/s1
Standard InChI Key: LULXJCXWYIGVOU-MAUKXSAKSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
12.3322 -3.0624 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.7449 -2.3566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9273 -2.3521 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.9488 -5.0311 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.1605 -4.8206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3724 -5.6085 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.4533 -2.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4522 -3.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1644 -4.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8782 -3.5925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8753 -2.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1626 -2.3605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5834 -2.3561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3353 -2.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8798 -2.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4685 -1.3619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6658 -1.5390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6970 -2.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1790 -1.4916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9961 -1.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6592 -2.0525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7415 -1.2353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9914 -2.8011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5106 -3.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8439 -4.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6617 -4.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1452 -3.6300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8052 -2.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4564 -5.2317 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.7469 -1.5428 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.9963 -5.0467 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.9584 -3.7104 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 13 1 0
11 13 1 0
15 18 1 0
18 19 1 0
20 19 1 6
21 20 1 0
22 21 1 0
20 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
21 23 1 1
9 5 1 0
5 29 1 0
7 2 1 0
2 30 1 0
26 31 1 0
27 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.34Molecular Weight (Monoisotopic): 462.1091AlogP: 5.23#Rotatable Bonds: 5Polar Surface Area: 42.74Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.47CX LogP: 5.32CX LogD: 4.99Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: -1.69
References 1. Huang MJ, Guo JW, Fu YD, You YZ, Xu WY, Song TY, Li R, Chen ZT, Huang LH, Liu HM.. (2021) Discovery of new tranylcypromine derivatives as highly potent LSD1 inhibitors., 41 [PMID:33775841 ] [10.1016/j.bmcl.2021.127993 ]