(2S,4aR,6aS,6bR,10aS,10bS)-6b-(2-Amino-acetyl)-8-(1S,2S)-cyclohexyl-5-hydroxy-4a,6a-dimethyl-4a,4b,5,6,6a,6b,9a,10,10a,10b,11,12-dodecahydro-7,9-dioxa-pentaleno[2,1-a]phenanthren-2-one

ID: ALA4875794

PubChem CID: 164626170

Max Phase: Preclinical

Molecular Formula: C28H39NO5

Molecular Weight: 469.62

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1C[C@H]1O[C@@H](C3CCCCC3)O[C@]12C(=O)CN

Standard InChI:  InChI=1S/C28H39NO5/c1-26-11-10-18(30)12-17(26)8-9-19-20-13-23-28(22(32)15-29,27(20,2)14-21(31)24(19)26)34-25(33-23)16-6-4-3-5-7-16/h10-12,16,19-21,23-25,31H,3-9,13-15,29H2,1-2H3/t19-,20-,21-,23+,24+,25+,26-,27-,28+/m0/s1

Standard InChI Key:  MSBIGGUKWRHBSQ-ZXBNPROVSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
    5.8866   -8.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8866   -8.9090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6063   -9.3211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6063   -7.6684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3177   -8.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3184   -8.9131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0265   -9.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7427   -8.9108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0293   -7.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7465   -8.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7384   -6.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0305   -6.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4597   -6.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4591   -7.6684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2411   -7.9264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2430   -6.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7276   -7.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5114   -6.9950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5169   -6.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7283   -5.9233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0247   -5.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6095   -5.2017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3083   -6.4158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3144   -7.2520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1692   -9.3304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4585   -8.4884    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.1112   -7.9847    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.2086   -5.7338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9464   -6.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6358   -5.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5959   -4.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8661   -4.4658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1704   -4.9156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7424   -7.2520    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.4585   -6.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0222   -8.4926    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2280   -5.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0132   -4.7790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  1  0
  3  6  2  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 17  1  0
 16 13  1  0
 16 17  1  0
 17 18  1  0
 19 18  1  0
 19 20  1  0
 20 16  1  0
 16 21  1  1
 21 22  2  0
 12 23  1  1
  5 24  1  1
  2 25  2  0
 14 26  1  6
 17 27  1  1
 19 28  1  6
 28 29  1  0
 28 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 10 34  1  1
 13 35  1  1
  9 36  1  6
 21 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875794

    ---

Associated Targets(non-human)

Vero C1008 (1716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.62Molecular Weight (Monoisotopic): 469.2828AlogP: 3.46#Rotatable Bonds: 3
Polar Surface Area: 98.85Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.74CX LogP: 3.53CX LogD: 3.03
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.66Np Likeness Score: 2.17

References

1. Tsuji G, Yonemitsu K, Ito T, Yanase Y, Uema M, Ohoka N, Inoue T, Asakura H, Demizu Y..  (2021)  Development of ciclesonide analogues that block SARS-CoV-2 RNA replication.,  43  [PMID:33887440] [10.1016/j.bmcl.2021.128052]

Source