2-(4-chlorobenzoyl)-N-(2-(trifluoromethyl)phenyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide

ID: ALA4875813

PubChem CID: 164626532

Max Phase: Preclinical

Molecular Formula: C24H18ClF3N2O2

Molecular Weight: 458.87

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccccc1C(F)(F)F)C1c2ccccc2CCN1C(=O)c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C24H18ClF3N2O2/c25-17-11-9-16(10-12-17)23(32)30-14-13-15-5-1-2-6-18(15)21(30)22(31)29-20-8-4-3-7-19(20)24(26,27)28/h1-12,21H,13-14H2,(H,29,31)

Standard InChI Key:  QJVULPRNJGULCI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    5.4314  -14.6929    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.8536  -14.1151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6421  -14.9044    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.9136  -10.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9125  -11.2696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6205  -11.6786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6187  -10.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3273  -10.4465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3281  -11.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0366  -11.6726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7449  -11.2618    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7402  -10.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0311  -10.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0383  -12.4898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3315  -12.8998    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7469  -12.8969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3332  -13.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6247  -14.1220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6260  -14.9384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3351  -15.3463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0443  -14.9319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0395  -14.1168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4542  -11.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4574  -12.4848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1603  -11.2563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8668  -11.6665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5724  -11.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5697  -10.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8554  -10.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1527  -10.4451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2753  -10.0255    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.2608  -13.4066    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  8  1  0
 10 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 11 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
 22  2  1  0
  2 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875813

    ---

Associated Targets(Human)

NUGC-3 (976 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.87Molecular Weight (Monoisotopic): 458.1009AlogP: 5.74#Rotatable Bonds: 3
Polar Surface Area: 49.41Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.04CX Basic pKa: CX LogP: 5.64CX LogD: 5.64
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -1.32

References

1. Sim S, Lee S, Ko S, Phuong Bui B, Linh Nguyen P, Cho J, Lee K, Kang JS, Jung JK, Lee H..  (2021)  Design, synthesis, and biological evaluation of potent 1,2,3,4-tetrahydroisoquinoline derivatives as anticancer agents targeting NF-κB signaling pathway.,  46  [PMID:34500188] [10.1016/j.bmc.2021.116371]

Source