4-((4-(tert-Butyl)phenyl)sulfonyl)-1-(4,5-dichloro-2-methoxyphenyl)-5-methyl-1H-1,2,3-triazole

ID: ALA4875869

PubChem CID: 130471970

Max Phase: Preclinical

Molecular Formula: C20H21Cl2N3O3S

Molecular Weight: 454.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(Cl)c(Cl)cc1-n1nnc(S(=O)(=O)c2ccc(C(C)(C)C)cc2)c1C

Standard InChI:  InChI=1S/C20H21Cl2N3O3S/c1-12-19(29(26,27)14-8-6-13(7-9-14)20(2,3)4)23-24-25(12)17-10-15(21)16(22)11-18(17)28-5/h6-11H,1-5H3

Standard InChI Key:  YIEWGQHWJYPOCX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   44.3141  -29.2703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.6042  -28.8576    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   43.6032  -29.6772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.3517  -27.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3506  -28.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0627  -28.5920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7765  -28.1826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7737  -27.3558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0609  -26.9464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4850  -28.5881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.5717  -29.4048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.3755  -29.5735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.7830  -28.8609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2310  -28.2546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0625  -29.4133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.3506  -29.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4037  -27.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0140  -28.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8359  -28.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2415  -27.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8300  -26.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0044  -26.7310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5984  -27.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2347  -26.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.0560  -26.0066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8223  -25.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6430  -25.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0585  -26.1292    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   38.6435  -26.9516    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
  7 10  1  0
  6 15  1  0
 15 16  1  0
 14 17  1  0
 13  2  1  0
  2 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
  9 28  1  0
  4 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4875869

    ---

Associated Targets(Human)

NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.38Molecular Weight (Monoisotopic): 453.0681AlogP: 5.02#Rotatable Bonds: 4
Polar Surface Area: 74.08Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.02CX LogD: 6.02
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.55Np Likeness Score: -1.80

References

1. Li Y, Lin W, Wright WC, Chai SC, Wu J, Chen T..  (2021)  Building a Chemical Toolbox for Human Pregnane X Receptor Research: Discovery of Agonists, Inverse Agonists, and Antagonists Among Analogs Based on the Unique Chemical Scaffold of SPA70.,  64  (3.0): [PMID:33497575] [10.1021/acs.jmedchem.0c02201]

Source