The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-acetamido-N-(5-((1-(4-fluorobenzyl)piperidin-4-yl)methoxy)pyridin-3-yl)isonicotinamide ID: ALA4875903
PubChem CID: 164628497
Max Phase: Preclinical
Molecular Formula: C26H28FN5O3
Molecular Weight: 477.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1cc(C(=O)Nc2cncc(OCC3CCN(Cc4ccc(F)cc4)CC3)c2)ccn1
Standard InChI: InChI=1S/C26H28FN5O3/c1-18(33)30-25-12-21(6-9-29-25)26(34)31-23-13-24(15-28-14-23)35-17-20-7-10-32(11-8-20)16-19-2-4-22(27)5-3-19/h2-6,9,12-15,20H,7-8,10-11,16-17H2,1H3,(H,31,34)(H,29,30,33)
Standard InChI Key: IGURROANDGIDJI-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
10.9365 -32.6655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6549 -33.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3714 -32.6705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3808 -31.8416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6608 -31.4201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9338 -31.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0963 -31.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0963 -30.6043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8149 -30.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8247 -29.3669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1067 -28.9461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3799 -29.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3819 -30.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8007 -33.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5014 -32.7135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2316 -33.1034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0793 -32.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3792 -33.1877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4041 -34.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1351 -34.4020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8324 -33.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6533 -32.7974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9524 -33.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2266 -32.8406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2033 -32.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4783 -31.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7764 -32.0601 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8041 -32.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5295 -33.2745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1048 -33.3239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3775 -32.9362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6849 -33.3721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3496 -32.1126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9773 -34.0546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1115 -28.1142 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
4 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
14 15 1 0
15 16 1 0
16 1 1 0
14 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 14 1 0
18 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
28 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
23 34 2 0
11 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.54Molecular Weight (Monoisotopic): 477.2176AlogP: 4.12#Rotatable Bonds: 8Polar Surface Area: 96.45Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.06CX Basic pKa: 8.29CX LogP: 2.66CX LogD: 1.72Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.51Np Likeness Score: -1.80
References 1. Jiang X, Liu C, Zou M, Xie H, Lin T, Lyu W, Xu J, Li Y, Feng F, Sun H, Liu W.. (2021) Discovery of 2-(cyclopropanecarboxamido)-N-(5-((1-(4-fluorobenzyl)piperidin-4-yl)methoxy)pyridin-3-yl)isonicotinamide as a potent dual AChE/GSK3β inhibitor for the treatment of Alzheimer's disease: Significantly increasing the level of acetylcholine in the brain without affecting that in intestine., 223 [PMID:34198150 ] [10.1016/j.ejmech.2021.113663 ]