S-4-methoxybenzyl 4-methylbenzenthiosulfonate

ID: ALA4875944

PubChem CID: 11958102

Max Phase: Preclinical

Molecular Formula: C15H16O3S2

Molecular Weight: 308.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CSS(=O)(=O)c2ccc(C)cc2)cc1

Standard InChI:  InChI=1S/C15H16O3S2/c1-12-3-9-15(10-4-12)20(16,17)19-11-13-5-7-14(18-2)8-6-13/h3-10H,11H2,1-2H3

Standard InChI Key:  SJBOKLOBSYZREV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
   11.9896   -9.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3766   -9.4183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0865   -9.8269    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.0854   -9.0079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6827  -10.5411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0995  -11.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6943  -11.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8759  -11.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4648  -11.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8664  -10.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9046   -9.8261    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.4743  -12.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3094   -9.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1266   -9.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5389   -9.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3561   -9.8171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7610   -9.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3486   -8.3990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5314   -8.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5781   -9.1015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  3 11  1  0
  5  3  1  0
  8 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 14 19  2  0
 11 13  1  0
 17 20  1  0
 20  1  1  0
M  END

Associated Targets(Human)

ACHE Tclin Acetylcholinesterase (18204 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BCHE Tclin Butyrylcholinesterase (7174 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 308.42Molecular Weight (Monoisotopic): 308.0541AlogP: 3.63#Rotatable Bonds: 5
Polar Surface Area: 43.37Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.11CX LogD: 4.11
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.79Np Likeness Score: -0.77

References

1. Zilbeyaz K, Oztekin A, Kutluana EG..  (2021)  Design and synthesis of garlic-related unsymmetrical thiosulfonates as potential Alzheimer's disease therapeutics: In vitro and in silico study.,  40  [PMID:33979775] [10.1016/j.bmc.2021.116194]

Source