N-(3-Ethylphenyl)-4-(2-((4-methoxybenzyl)amino)-2-oxoethoxy)benzamide

ID: ALA4875962

PubChem CID: 164625960

Max Phase: Preclinical

Molecular Formula: C25H26N2O4

Molecular Weight: 418.49

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1cccc(NC(=O)c2ccc(OCC(=O)NCc3ccc(OC)cc3)cc2)c1

Standard InChI:  InChI=1S/C25H26N2O4/c1-3-18-5-4-6-21(15-18)27-25(29)20-9-13-23(14-10-20)31-17-24(28)26-16-19-7-11-22(30-2)12-8-19/h4-15H,3,16-17H2,1-2H3,(H,26,28)(H,27,29)

Standard InChI Key:  YHYCVYDABVDJRS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    2.2078  -16.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9175  -15.9247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9175  -15.1020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2060  -14.6968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5010  -15.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5010  -15.9252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7935  -14.6951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7935  -13.8779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6258  -16.3322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3329  -15.9225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0412  -16.3299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7483  -15.9202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4566  -16.3277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1637  -15.9180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8692  -16.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5750  -15.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5750  -15.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8616  -14.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1637  -15.1027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2815  -14.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2815  -13.8708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9904  -15.0945    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6969  -14.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4029  -15.0909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1089  -14.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1089  -13.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3931  -13.4565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6969  -13.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3931  -12.6394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6776  -12.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0412  -17.1471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  6  5  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  2  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 27 29  1  0
 29 30  1  0
 11 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4875962

    ---

Associated Targets(Human)

MEIS1 Tbio Homeobox protein Meis1 (130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.49Molecular Weight (Monoisotopic): 418.1893AlogP: 4.21#Rotatable Bonds: 9
Polar Surface Area: 76.66Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.33CX Basic pKa: CX LogP: 4.33CX LogD: 4.33
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -1.42

References

1. Turgutalp B, Uslu M, Helvacioglu S, Charehsaz M, Gurdal EE, Sippl W, Kocabas F, Yarim M..  (2021)  Lead Optimization and Structure-Activity Relationship Studies on Myeloid Ecotropic Viral Integration Site 1 Inhibitor.,  64  (19.0): [PMID:34542289] [10.1021/acs.jmedchem.1c00972]

Source